Difference between revisions of "Tiso gene 18322"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHO-ENOL-PYRUVATE PHOSPHO-ENOL-PYRUVATE] == * smiles: ** C=C(OP([O-])([O-])=O)C([O-])=O * i...") |
(Created page with "Category:Gene == Gene Tiso_gene_7495 == * left end position: ** 7623 * transcription direction: ** POSITIVE * right end position: ** 9984 * centisome position: ** 68.65712...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_7495 == |
− | * | + | * left end position: |
− | ** | + | ** 7623 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 9984 |
− | * | + | * centisome position: |
− | ** | + | ** 68.65712 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[ASNSYNA-RXN]] |
− | * [[ | + | ** in-silico_annotation |
− | + | ***ec-number | |
− | * [[ | + | ** [[pantograph]]-[[esiliculosus]] |
− | * [[ | + | * [[ASNSYNB-RXN]] |
− | + | ** in-silico_annotation | |
− | + | ***ec-number | |
− | * [[ | + | ** [[pantograph]]-[[esiliculosus]] |
− | * | + | * [[GLUTAMIN-RXN]] |
− | + | ** in-silico_annotation | |
− | * | + | ***ec-number |
− | * [[ | + | ** [[pantograph]]-[[esiliculosus]] |
− | + | == Pathways associated == | |
− | * [[ | + | * [[ASPARAGINE-BIOSYNTHESIS]] |
− | * [[ | + | * [[ASPARAGINESYN-PWY]] |
− | * [[ | + | * [[GLUTAMINDEG-PWY]] |
− | * [[ | + | * [[CITRULBIO-PWY]] |
== External links == | == External links == | ||
− | + | {{#set: left end position=7623}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=9984}} | |
− | + | {{#set: centisome position=68.65712 }} | |
− | + | {{#set: reaction associated=ASNSYNA-RXN|ASNSYNB-RXN|GLUTAMIN-RXN}} | |
− | + | {{#set: pathway associated=ASPARAGINE-BIOSYNTHESIS|ASPARAGINESYN-PWY|GLUTAMINDEG-PWY|CITRULBIO-PWY}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | + |
Revision as of 18:27, 10 January 2018
Gene Tiso_gene_7495
- left end position:
- 7623
- transcription direction:
- POSITIVE
- right end position:
- 9984
- centisome position:
- 68.65712
- Synonym(s):
Reactions associated
- ASNSYNA-RXN
- in-silico_annotation
- ec-number
- pantograph-esiliculosus
- in-silico_annotation
- ASNSYNB-RXN
- in-silico_annotation
- ec-number
- pantograph-esiliculosus
- in-silico_annotation
- GLUTAMIN-RXN
- in-silico_annotation
- ec-number
- pantograph-esiliculosus
- in-silico_annotation