Difference between revisions of "Tiso gene 12155"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3Z-PHYTOCHROMOBILIN 3Z-PHYTOCHROMOBILIN] == * smiles: ** CC=C1(C(C)C(NC1=CC4(=C(C)C(CCC([O-])=O...")
 
(Created page with "Category:Gene == Gene Tiso_gene_9411 == * left end position: ** 42 * transcription direction: ** POSITIVE * right end position: ** 5144 * centisome position: ** 0.4482391...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3Z-PHYTOCHROMOBILIN 3Z-PHYTOCHROMOBILIN] ==
+
== Gene Tiso_gene_9411 ==
−
* smiles:
+
* left end position:
−
** CC=C1(C(C)C(NC1=CC4(=C(C)C(CCC([O-])=O)=C(C=C2(C(CCC([O-])=O)=C(C)C(=N2)C=C3(C(C)=C(C=C)C(=O)N3)))N4))=O)
+
** 42
−
* inchi key:
+
* transcription direction:
−
** InChIKey=DKMLMZVDTGOEGU-AIKFXVFZSA-L
+
** POSITIVE
−
* common name:
+
* right end position:
−
** (3Z)-phytochromobilin
+
** 5144
−
* molecular weight:
+
* centisome position:
−
** 582.655    
+
** 0.4482391    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[NAD+-ADP-RIBOSYLTRANSFERASE-RXN]]
−
* [[1.3.7.4-RXN]]
+
** in-silico_annotation
−
== Reaction(s) of unknown directionality ==
+
***ec-number
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=42}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246013 25246013]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=CC=C1(C(C)C(NC1=CC4(=C(C)C(CCC([O-])=O)=C(C=C2(C(CCC([O-])=O)=C(C)C(=N2)C=C3(C(C)=C(C=C)C(=O)N3)))N4))=O)}}
+
{{#set: right end position=5144}}
−
{{#set: inchi key=InChIKey=DKMLMZVDTGOEGU-AIKFXVFZSA-L}}
+
{{#set: centisome position=0.4482391   }}
−
{{#set: common name=(3Z)-phytochromobilin}}
+
{{#set: reaction associated=NAD+-ADP-RIBOSYLTRANSFERASE-RXN}}
−
{{#set: molecular weight=582.655   }}
+
−
{{#set: produced by=1.3.7.4-RXN}}
+

Revision as of 17:27, 10 January 2018

Gene Tiso_gene_9411

  • left end position:
    • 42
  • transcription direction:
    • POSITIVE
  • right end position:
    • 5144
  • centisome position:
    • 0.4482391
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_12155&oldid=17913"