Difference between revisions of "3Z-PHYTOCHROMOBILIN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_14849 == * left end position: ** 50 * transcription direction: ** POSITIVE * right end position: ** 4421 * centisome position: ** 0.9274717...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9460 CPD-9460] == * smiles: ** CC6(CCC5(CCC1(C(=CC[CH]2(C1(CC[CH]3(C2(CCC(C3(C)C)OC4(C(C(C(...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_14849 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9460 CPD-9460] ==
−
* left end position:
+
* smiles:
−
** 50
+
** CC6(CCC5(CCC1(C(=CC[CH]2(C1(CC[CH]3(C2(CCC(C3(C)C)OC4(C(C(C(C(O4)C(=O)[O-])O)O)O))C))C))[CH]5C6)C)C(=O)[O-])C
−
* transcription direction:
+
* inchi key:
−
** POSITIVE
+
** InChIKey=IUCHKMAZAWJNBJ-RCYXVVTDSA-L
−
* right end position:
+
* common name:
−
** 4421
+
** oleanolate 3 β-D-glucuronoside
−
* centisome position:
+
* molecular weight:
−
** 0.92747176    
+
** 630.817    
 
* Synonym(s):
 
* Synonym(s):
 +
** oleanolic acid 3 β-D-glucuronoside
 +
** oleanoic acid 3-O-glucuronide
 +
** monoglucuronide F
 +
** oleanolic acid 3-O-glucuronide
 +
** oleanolic acid 3-O-monoglucuronide
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[3.2.1.55-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** in-silico_annotation
+
* [[RXN-9000]]
−
***ec-number
+
== Reaction(s) of unknown directionality ==
−
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=50}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659092 90659092]
−
{{#set: right end position=4421}}
+
* CHEBI:
−
{{#set: centisome position=0.92747176   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=37658 37658]
−
{{#set: reaction associated=3.2.1.55-RXN}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C08964 C08964]
 +
* HMDB : HMDB40851
 +
{{#set: smiles=CC6(CCC5(CCC1(C(=CC[CH]2(C1(CC[CH]3(C2(CCC(C3(C)C)OC4(C(C(C(C(O4)C(=O)[O-])O)O)O))C))C))[CH]5C6)C)C(=O)[O-])C}}
 +
{{#set: inchi key=InChIKey=IUCHKMAZAWJNBJ-RCYXVVTDSA-L}}
 +
{{#set: common name=oleanolate 3 β-D-glucuronoside}}
 +
{{#set: molecular weight=630.817   }}
 +
{{#set: common name=oleanolic acid 3 β-D-glucuronoside|oleanoic acid 3-O-glucuronide|monoglucuronide F|oleanolic acid 3-O-glucuronide|oleanolic acid 3-O-monoglucuronide}}
 +
{{#set: produced by=RXN-9000}}

Revision as of 18:27, 10 January 2018

Metabolite CPD-9460

  • smiles:
    • CC6(CCC5(CCC1(C(=CC[CH]2(C1(CC[CH]3(C2(CCC(C3(C)C)OC4(C(C(C(C(O4)C(=O)[O-])O)O)O))C))C))[CH]5C6)C)C(=O)[O-])C
  • inchi key:
    • InChIKey=IUCHKMAZAWJNBJ-RCYXVVTDSA-L
  • common name:
    • oleanolate 3 β-D-glucuronoside
  • molecular weight:
    • 630.817
  • Synonym(s):
    • oleanolic acid 3 β-D-glucuronoside
    • oleanoic acid 3-O-glucuronide
    • monoglucuronide F
    • oleanolic acid 3-O-glucuronide
    • oleanolic acid 3-O-monoglucuronide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC6(CCC5(CCC1(C(=CC[CH]2(C1(CC[CH]3(C2(CCC(C3(C)C)OC4(C(C(C(C(O4)C(=O)[O-])O)O)O))C))C))[CH]5C6)C)C(=O)[O-])C" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=3Z-PHYTOCHROMOBILIN&oldid=17919"