Difference between revisions of "Tiso gene 5281"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7424 CPD-7424] == * smiles: ** CC(C=CC=C(C)[CH]=C=C1(C(O)(C)CC(O)CC(C)(C)1))=CC=CC=C(C)C=CC...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PSII-RXN PSII-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** Photosystem II D2 protein * e...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7424 CPD-7424] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=PSII-RXN PSII-RXN] ==
−
* smiles:
+
* direction:
−
** CC(C=CC=C(C)[CH]=C=C1(C(O)(C)CC(O)CC(C)(C)1))=CC=CC=C(C)C=CC=C(C)C=CC23(C(C)(C)CC(O)CC(C)(O2)3)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=PGYAYSRVSAJXTE-OQASCVKESA-N
+
 
* common name:
 
* common name:
−
** 9'-cis-neoxanthin
+
** Photosystem II D2 protein
−
* molecular weight:
+
* ec number:
−
** 600.88   
+
** [http://enzyme.expasy.org/EC/1.10.3.9 EC-1.10.3.9]
 
* Synonym(s):
 
* Synonym(s):
−
** 9cNeox
 
−
** 9c-neoxanthin
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-698]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 2 [[PLASTOQUINONE]][c] '''+''' 1 [[Light]][c] '''+''' 4 [[PROTON]][e] '''+''' 2 [[WATER]][c] '''=>''' 2 [[Plastoquinols]][c] '''+''' 4 [[PROTON]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 2 a plastoquinone[c] '''+''' 1 hν[c] '''+''' 4 H+[e] '''+''' 2 H2O[c] '''=>''' 2 a plastoquinol[c] '''+''' 4 H+[c] '''+''' 1 oxygen[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_13951]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
* [[Tiso_gene_5033]]
 +
** EXPERIMENTAL_ANNOTATION
 +
***EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-101]], photosynthesis light reactions: [http://metacyc.org/META/NEW-IMAGE?object=PWY-101 PWY-101]
 +
** '''3''' reactions found over '''4''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* [[orthology]]:
 +
** [[pantograph]]:
 +
*** [[esiliculosus]]
 +
* [[annotation]]:
 +
** [[pathwaytools]]:
 +
*** [[experimental_annotation]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* RHEA:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5282217 5282217]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=30250 30250]
−
* CHEMSPIDER:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.chemspider.com/Chemical-Structure.10392237.html 10392237]
+
{{#set: common name=Photosystem II D2 protein}}
−
* CHEBI:
+
{{#set: ec number=EC-1.10.3.9}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=35306 35306]
+
{{#set: gene associated=Tiso_gene_13951|Tiso_gene_5033}}
−
* LIGAND-CPD:
+
{{#set: in pathway=PWY-101}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C13431 C13431]
+
{{#set: reconstruction category=orthology}}
−
{{#set: smiles=CC(C=CC=C(C)[CH]=C=C1(C(O)(C)CC(O)CC(C)(C)1))=CC=CC=C(C)C=CC=C(C)C=CC23(C(C)(C)CC(O)CC(C)(O2)3)}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: inchi key=InChIKey=PGYAYSRVSAJXTE-OQASCVKESA-N}}
+
{{#set: reconstruction source=esiliculosus}}
−
{{#set: common name=9'-cis-neoxanthin}}
+
{{#set: reconstruction category=annotation}}
−
{{#set: molecular weight=600.88    }}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: common name=9cNeox|9c-neoxanthin}}
+
{{#set: reconstruction source=experimental_annotation}}
−
{{#set: consumed by=RXN-698}}
+

Revision as of 17:28, 10 January 2018

Reaction PSII-RXN

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Photosystem II D2 protein
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-101, photosynthesis light reactions: PWY-101
    • 3 reactions found over 4 reactions in the full pathway

Reconstruction information

External links






Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_5281&oldid=17965"