Difference between revisions of "Tiso gene 5405"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Keratan-sulfate-NAcGlc Keratan-sulfate-NAcGlc] == * common name: ** [keratan sulfate]-α-N...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXY-CISCIS-MUCONATE 3-HYDROXY-CISCIS-MUCONATE] == * smiles: ** C(=CC(=O)[O-])C(O)=CC(=O)[...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXY-CISCIS-MUCONATE 3-HYDROXY-CISCIS-MUCONATE] == |
+ | * smiles: | ||
+ | ** C(=CC(=O)[O-])C(O)=CC(=O)[O-] | ||
+ | * inchi key: | ||
+ | ** InChIKey=DLKZGMNZEDNHKO-BXTBVDPRSA-L | ||
* common name: | * common name: | ||
− | ** | + | ** 3-hydroxy-cis,cis-muconate |
+ | * molecular weight: | ||
+ | ** 156.095 | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[RXN-9922]] | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54729369 54729369] |
− | {{#set: produced by=RXN- | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58139 58139] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C03676 C03676] | ||
+ | {{#set: smiles=C(=CC(=O)[O-])C(O)=CC(=O)[O-]}} | ||
+ | {{#set: inchi key=InChIKey=DLKZGMNZEDNHKO-BXTBVDPRSA-L}} | ||
+ | {{#set: common name=3-hydroxy-cis,cis-muconate}} | ||
+ | {{#set: molecular weight=156.095 }} | ||
+ | {{#set: consumed or produced by=RXN-9922}} |
Revision as of 17:29, 10 January 2018
Contents
Metabolite 3-HYDROXY-CISCIS-MUCONATE
- smiles:
- C(=CC(=O)[O-])C(O)=CC(=O)[O-]
- inchi key:
- InChIKey=DLKZGMNZEDNHKO-BXTBVDPRSA-L
- common name:
- 3-hydroxy-cis,cis-muconate
- molecular weight:
- 156.095
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(=CC(=O)[O-])C(O)=CC(=O)[O-" cannot be used as a page name in this wiki.