Difference between revisions of "Tiso gene 17975"

Revision as of 17:29, 10 January 2018

"CC1(=C(OC(C1)=O)CC([O-])=O)" cannot be used as a page name in this wiki.

@@ Line 1: / Line 1: @@
-[[Category:Gene]]
+[[Category:Metabolite]]
-== Gene Tiso_gene_5281 ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10825 CPD-10825] ==
-* left end position:
+* smiles:
-** 3545
+** CC1(=C(OC(C1)=O)CC([O-])=O)
-* transcription direction:
+* inchi key:
-** POSITIVE
+** InChIKey=DAJDHKXIQYXYPH-UHFFFAOYSA-M
-* right end position:
+* common name:
-** 5113
+** 4-methyl-3-oxoadipate-enol-lactone
-* centisome position:
+* molecular weight:
-** 25.889141
+** 155.13
 * Synonym(s):
-== Reactions associated ==
+== Reaction(s) known to consume the compound ==
-* [[GLYOXII-RXN]]
+* [[RXN-10083]]
-** in-silico_annotation
+== Reaction(s) known to produce the compound ==
-***ec-number
+== Reaction(s) of unknown directionality ==
-* [[RXN-7919]]
-** in-silico_annotation
-***ec-number
-== Pathways associated ==
-* [[PWY-5386]]
 == External links  ==
-{{#set: left end position=3545}}
+* PUBCHEM:
-{{#set: transcription direction=POSITIVE}}
+** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44123582 44123582]
-{{#set: right end position=5113}}
+{{#set: smiles=CC1(=C(OC(C1)=O)CC([O-])=O)}}
-{{#set: centisome position=25.889141    }}
+{{#set: inchi key=InChIKey=DAJDHKXIQYXYPH-UHFFFAOYSA-M}}
-{{#set: reaction associated=GLYOXII-RXN|RXN-7919}}
+{{#set: common name=4-methyl-3-oxoadipate-enol-lactone}}
-{{#set: pathway associated=PWY-5386}}
+{{#set: molecular weight=155.13    }}
+{{#set: consumed by=RXN-10083}}