Difference between revisions of "R02984"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6994 CPD-6994] == * smiles: ** C3(C(C2(OC1(C=C(C=C(C=1C(C2)=O)O)[O-])))=CC(=C(C=3)O)O) * in...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7580 RXN-7580] == * direction: ** LEFT-TO-RIGHT * common name: ** ent-kaurenal 19-hydroxylase *...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7580 RXN-7580] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** ent-kaurenal 19-hydroxylase |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | == | + | ** 1 [[ENT-KAUR-16-EN-19-AL]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[NADPH]][c] '''=>''' 1 [[CPD1F-132]][c] '''+''' 1 [[NADP]][c] '''+''' 1 [[WATER]][c] |
| − | == | + | * With common name(s): |
| + | ** 1 ent-kaurenal[c] '''+''' 1 oxygen[c] '''+''' 1 NADPH[c] '''=>''' 1 ent-kaur-16-en-19-oate[c] '''+''' 1 NADP+[c] '''+''' 1 H2O[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * [[Tiso_gene_8263]] | ||
| + | ** [[pantograph]]-[[athaliana]] | ||
| + | * [[Tiso_gene_1547]] | ||
| + | ** [[pantograph]]-[[athaliana]] | ||
| + | == Pathways == | ||
| + | * [[PWY-5047]], gibberellin biosynthesis IV (Gibberella fujikuroi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5047 PWY-5047] | ||
| + | ** '''6''' reactions found over '''15''' reactions in the full pathway | ||
| + | * [[PWY-5034]], GA12 biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5034 PWY-5034] | ||
| + | ** '''6''' reactions found over '''6''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * [[orthology]]: | ||
| + | ** [[pantograph]]: | ||
| + | *** [[athaliana]] | ||
== External links == | == External links == | ||
| − | * | + | * RHEA: |
| − | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=10931 10931] | |
| − | + | * LIGAND-RXN: | |
| − | ** [http://www.ebi.ac.uk/ | + | ** [http://www.genome.jp/dbget-bin/www_bget?R06293 R06293] |
| − | * LIGAND- | + | {{#set: direction=LEFT-TO-RIGHT}} |
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: common name=ent-kaurenal 19-hydroxylase}} |
| − | + | {{#set: gene associated=Tiso_gene_8263|Tiso_gene_1547}} | |
| − | {{#set: | + | {{#set: in pathway=PWY-5047|PWY-5034}} |
| − | {{#set: | + | {{#set: reconstruction category=orthology}} |
| − | {{#set: | + | {{#set: reconstruction tool=pantograph}} |
| − | {{#set: | + | {{#set: reconstruction source=athaliana}} |
| − | {{#set: | + | |
Revision as of 17:29, 10 January 2018
Contents
Reaction RXN-7580
- direction:
- LEFT-TO-RIGHT
- common name:
- ent-kaurenal 19-hydroxylase
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 ENT-KAUR-16-EN-19-AL[c] + 1 OXYGEN-MOLECULE[c] + 1 NADPH[c] => 1 CPD1F-132[c] + 1 NADP[c] + 1 WATER[c]
- With common name(s):
- 1 ent-kaurenal[c] + 1 oxygen[c] + 1 NADPH[c] => 1 ent-kaur-16-en-19-oate[c] + 1 NADP+[c] + 1 H2O[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
Pathways
- PWY-5047, gibberellin biosynthesis IV (Gibberella fujikuroi): PWY-5047
- 6 reactions found over 15 reactions in the full pathway
- PWY-5034, GA12 biosynthesis: PWY-5034
- 6 reactions found over 6 reactions in the full pathway
Reconstruction information
External links
