Difference between revisions of "RXN-12037"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9025 RXN-9025] == * direction: ** LEFT-TO-RIGHT * common name: ** thymidine_phosphorylase * ec...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7137 CPD-7137] == * smiles: ** C(O)C5(C(C(C(C(OC3(=CC([O-])=CC2([O+]=C(C1(=CC=C(O)C=C1))C(=...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9025 RXN-9025] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7137 CPD-7137] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(O)C5(C(C(C(C(OC3(=CC([O-])=CC2([O+]=C(C1(=CC=C(O)C=C1))C(=CC=23)OC4(C(O)C(O)C(O)C(CO)O4))))O5)O)O)O)
 +
* inchi key:
 +
** InChIKey=SLCKJKWFULXZBD-ZOTFFYTFSA-N
 
* common name:
 
* common name:
−
** thymidine_phosphorylase
+
** pelargonidin-3,5-di-O-β-D-glucoside
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/2.4.1.1 EC-2.4.1.1]
+
** 594.525   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** n [[Pi]][c] '''+''' 1 [[CPD0-1027]][c] '''=>''' n [[GLC-1-P]][c]
+
* [[RXN-7828]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** n phosphate[c] '''+''' 1 a debranched α-limit dextrin[c] '''=>''' n α-D-glucopyranose 1-phosphate[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_1011]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWY-5941]], glycogen degradation II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5941 PWY-5941]
+
−
** '''3''' reactions found over '''6''' reactions in the full pathway
+
−
* [[GLYCOCAT-PWY]], glycogen degradation I: [http://metacyc.org/META/NEW-IMAGE?object=GLYCOCAT-PWY GLYCOCAT-PWY]
+
−
** '''6''' reactions found over '''8''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=thymidine_phosphorylase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=167643 167643]
−
{{#set: ec number=EC-2.4.1.1}}
+
* CHEBI:
−
{{#set: gene associated=Tiso_gene_1011}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57503 57503]
−
{{#set: in pathway=PWY-5941|GLYCOCAT-PWY}}
+
* LIGAND-CPD:
−
{{#set: reconstruction category=annotation}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C08725 C08725]
−
{{#set: reconstruction tool=pathwaytools}}
+
* HMDB : HMDB33681
−
{{#set: reconstruction source=in-silico_annotation}}
+
{{#set: smiles=C(O)C5(C(C(C(C(OC3(=CC([O-])=CC2([O+]=C(C1(=CC=C(O)C=C1))C(=CC=23)OC4(C(O)C(O)C(O)C(CO)O4))))O5)O)O)O)}}
 +
{{#set: inchi key=InChIKey=SLCKJKWFULXZBD-ZOTFFYTFSA-N}}
 +
{{#set: common name=pelargonidin-3,5-di-O-β-D-glucoside}}
 +
{{#set: molecular weight=594.525    }}
 +
{{#set: produced by=RXN-7828}}

Revision as of 17:29, 10 January 2018

Metabolite CPD-7137

  • smiles:
    • C(O)C5(C(C(C(C(OC3(=CC([O-])=CC2([O+]=C(C1(=CC=C(O)C=C1))C(=CC=23)OC4(C(O)C(O)C(O)C(CO)O4))))O5)O)O)O)
  • inchi key:
    • InChIKey=SLCKJKWFULXZBD-ZOTFFYTFSA-N
  • common name:
    • pelargonidin-3,5-di-O-β-D-glucoside
  • molecular weight:
    • 594.525
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(O)C5(C(C(C(C(OC3(=CC([O-])=CC2([O+]=C(C1(=CC=C(O)C=C1))C(=CC=23)OC4(C(O)C(O)C(O)C(CO)O4))))O5)O)O)O)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-12037&oldid=18056"