Difference between revisions of "RXN-10695"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14950 CPD-14950] == * smiles: ** COC3(C(=O)C1(C(=CC(O)=CC(O)=1)OC(C2(C=CC(O)=CC=2))=3)) * i...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Odd-Straight-Chain-234-Sat-FA Odd-Straight-Chain-234-Sat-FA] == * common name: ** an odd number...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Odd-Straight-Chain-234-Sat-FA Odd-Straight-Chain-234-Sat-FA] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** 3- | + | ** an odd numbered straight chain 2,3,4-saturated fatty acid |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN66-477]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN66-476]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=an odd numbered straight chain 2,3,4-saturated fatty acid}} | |
| − | + | {{#set: consumed by=RXN66-477}} | |
| − | + | {{#set: produced by=RXN66-476}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: common name=3- | + | |
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: produced by= | + | |
Revision as of 17:29, 10 January 2018
Contents
Metabolite Odd-Straight-Chain-234-Sat-FA
- common name:
- an odd numbered straight chain 2,3,4-saturated fatty acid
- Synonym(s):
