Difference between revisions of "ACYL-COA-OXIDASE-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-GLUCURONATE UDP-GLUCURONATE] == * smiles: ** C(C1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))OP(=O)(...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN3DJ-11417 RXN3DJ-11417] == * direction: ** LEFT-TO-RIGHT * common name: ** sphingosine_kinase_1...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-GLUCURONATE UDP-GLUCURONATE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN3DJ-11417 RXN3DJ-11417] ==
−
* smiles:
+
* direction:
−
** C(C1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))OP(=O)([O-])OP(=O)([O-])OC3(OC(C([O-])=O)C(O)C(O)C(O)3)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=HDYANYHVCAPMJV-LXQIFKJMSA-K
+
 
* common name:
 
* common name:
−
** UDP-α-D-glucuronate
+
** sphingosine_kinase_1
−
* molecular weight:
+
* ec number:
−
** 577.265   
+
** [http://enzyme.expasy.org/EC/2.7.1.91 EC-2.7.1.91]
 
* Synonym(s):
 
* Synonym(s):
−
** (UDP-GlcA)1
 
−
** UDP-D-glucuronic acid
 
−
** UDP-glucuronic acid
 
−
** udp-glcua
 
−
** UDP-glucuronate
 
−
** uridine diphosphate glucuronate
 
−
** uridine diphosphate glucuronic acid
 
−
** UDP-D-glucuronate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-14361]]
+
* With identifiers:
−
* [[UDP-GLUCURONATE-DECARBOXYLASE-RXN]]
+
** 1 [[ATP]][c] '''+''' 1 [[SPHINGOSINE]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[ADP]][c] '''+''' 1 [[CPD3DJ-11366]][c]
−
* [[RXN-9000]]
+
* With common name(s):
−
* [[RXN-10618]]
+
** 1 ATP[c] '''+''' 1 sphingosine[c] '''=>''' 1 H+[c] '''+''' 1 ADP[c] '''+''' 1 sphingosine 1-phosphate[c]
−
* [[RXN-10619]]
+
 
−
* [[RXN-10616]]
+
== Genes associated with this reaction  ==
−
* [[RXN-10617]]
+
Genes have been associated with this reaction based on different elements listed below.
−
* [[RXN-11060]]
+
* [[Tiso_gene_1163]]
−
* [[RXN66-83]]
+
** IN-SILICO_ANNOTATION
−
* [[UGDC]]
+
***AUTOMATED-NAME-MATCH
−
* [[UDP-GLUCURONOSYLTRANSFERASE-RXN]]
+
== Pathways  ==
−
* [[RXN-13608]]
+
* [[PWY3DJ-11470]], sphingosine and sphingosine-1-phosphate metabolism: [http://metacyc.org/META/NEW-IMAGE?object=PWY3DJ-11470 PWY3DJ-11470]
−
* [[RXN-10609]]
+
** '''3''' reactions found over '''5''' reactions in the full pathway
−
* [[RXN-10608]]
+
== Reconstruction information  ==
−
* [[RXN-10607]]
+
* [[annotation]]:
−
* [[RXN-10606]]
+
** [[pathwaytools]]:
−
* [[RXN-13607]]
+
*** [[in-silico_annotation]]
−
* [[2.4.1.135-RXN]]
+
−
* [[RXN66-168]]
+
−
* [[RXN-10784]]
+
−
* [[2.4.1.225-RXN]]
+
−
* [[RXN66-162]]
+
−
== Reaction(s) known to produce the compound ==
+
−
* [[GLCUR1PUT]]
+
−
== Reaction(s) of unknown directionality ==
+
−
* [[2.7.7.44-RXN]]
+
−
* [[UDP-GLUCURONATE-4-EPIMERASE-RXN]]
+
 
== External links  ==
 
== External links  ==
−
* CAS : 2616-64-0
+
* LIGAND-RXN:
−
* METABOLIGHTS : MTBLC58052
+
** [http://www.genome.jp/dbget-bin/www_bget?R01926 R01926]
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202620 25202620]
+
{{#set: common name=sphingosine_kinase_1}}
−
* HMDB : HMDB00935
+
{{#set: ec number=EC-2.7.1.91}}
−
* LIGAND-CPD:
+
{{#set: gene associated=Tiso_gene_1163}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00167 C00167]
+
{{#set: in pathway=PWY3DJ-11470}}
−
* CHEBI:
+
{{#set: reconstruction category=annotation}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58052 58052]
+
{{#set: reconstruction tool=pathwaytools}}
−
* BIGG : udpglcur
+
{{#set: reconstruction source=in-silico_annotation}}
−
{{#set: smiles=C(C1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))OP(=O)([O-])OP(=O)([O-])OC3(OC(C([O-])=O)C(O)C(O)C(O)3)}}
+
−
{{#set: inchi key=InChIKey=HDYANYHVCAPMJV-LXQIFKJMSA-K}}
+
−
{{#set: common name=UDP-α-D-glucuronate}}
+
−
{{#set: molecular weight=577.265    }}
+
−
{{#set: common name=(UDP-GlcA)1|UDP-D-glucuronic acid|UDP-glucuronic acid|udp-glcua|UDP-glucuronate|uridine diphosphate glucuronate|uridine diphosphate glucuronic acid|UDP-D-glucuronate}}
+
−
{{#set: consumed by=RXN-14361|UDP-GLUCURONATE-DECARBOXYLASE-RXN|RXN-9000|RXN-10618|RXN-10619|RXN-10616|RXN-10617|RXN-11060|RXN66-83|UGDC|UDP-GLUCURONOSYLTRANSFERASE-RXN|RXN-13608|RXN-10609|RXN-10608|RXN-10607|RXN-10606|RXN-13607|2.4.1.135-RXN|RXN66-168|RXN-10784|2.4.1.225-RXN|RXN66-162}}
+
−
{{#set: produced by=GLCUR1PUT}}
+
−
{{#set: consumed or produced by=2.7.7.44-RXN|UDP-GLUCURONATE-4-EPIMERASE-RXN}}
+

Revision as of 17:29, 10 January 2018

Reaction RXN3DJ-11417

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • sphingosine_kinase_1
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 ATP[c] + 1 sphingosine[c] => 1 H+[c] + 1 ADP[c] + 1 sphingosine 1-phosphate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY3DJ-11470, sphingosine and sphingosine-1-phosphate metabolism: PWY3DJ-11470
    • 3 reactions found over 5 reactions in the full pathway

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=ACYL-COA-OXIDASE-RXN&oldid=18079"