Difference between revisions of "RXN-10827"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_6426 == * Synonym(s): == Reactions associated == * 3PG_pi_thr ** pantograph-creinhardtii * DHAP_pi_thr ** pantograph-[...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12481 CPD-12481] == * smiles: ** CN1(C(=O)NC2(=C1C(=O)NC(=O)N2)) * inchi key: ** InChIKey=Y...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12481 CPD-12481] == |
| + | * smiles: | ||
| + | ** CN1(C(=O)NC2(=C1C(=O)NC(=O)N2)) | ||
| + | * inchi key: | ||
| + | ** InChIKey=YHNNPKUFPWLTOP-UHFFFAOYSA-N | ||
| + | * common name: | ||
| + | ** 7-methylurate | ||
| + | * molecular weight: | ||
| + | ** 182.138 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 7-methyluric acid | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-11521]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=69160 69160] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.62375.html 62375] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=80470 80470] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C16355 C16355] | ||
| + | * HMDB : HMDB11107 | ||
| + | {{#set: smiles=CN1(C(=O)NC2(=C1C(=O)NC(=O)N2))}} | ||
| + | {{#set: inchi key=InChIKey=YHNNPKUFPWLTOP-UHFFFAOYSA-N}} | ||
| + | {{#set: common name=7-methylurate}} | ||
| + | {{#set: molecular weight=182.138 }} | ||
| + | {{#set: common name=7-methyluric acid}} | ||
| + | {{#set: produced by=RXN-11521}} | ||
Revision as of 17:30, 10 January 2018
Contents
Metabolite CPD-12481
- smiles:
- CN1(C(=O)NC2(=C1C(=O)NC(=O)N2))
- inchi key:
- InChIKey=YHNNPKUFPWLTOP-UHFFFAOYSA-N
- common name:
- 7-methylurate
- molecular weight:
- 182.138
- Synonym(s):
- 7-methyluric acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
