Difference between revisions of "Tiso gene 17"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-29 CPD66-29] == * smiles: ** CC24(CCC(=O)CC(=CC[CH]1([CH]3(CCC(=O)C(CC[CH]12)(C)3)))4) *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-L-Aspartates Protein-L-Aspartates] == * common name: ** a [protein]-L-aspartate * Synon...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-L-Aspartates Protein-L-Aspartates] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** a [protein]-L-aspartate |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[PEPTIDE-ASPARTATE-BETA-DIOXYGENASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[3.5.1.52-RXN]] | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=a [protein]-L-aspartate}} | |
| − | + | {{#set: consumed by=PEPTIDE-ASPARTATE-BETA-DIOXYGENASE-RXN}} | |
| − | + | {{#set: consumed or produced by=3.5.1.52-RXN}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | {{#set: produced by= | + | |
Revision as of 18:30, 10 January 2018
Contents
Metabolite Protein-L-Aspartates
- common name:
- a [protein]-L-aspartate
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"a [protein]-L-aspartate" cannot be used as a page name in this wiki.
