Difference between revisions of "RXN3DJ-11417"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.2.4.4-RXN 1.2.4.4-RXN] == * direction: ** REVERSIBLE * common name: ** 3-methyl-2-oxobutanoate_de...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4578 CPD-4578] == * smiles: ** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C)C(=O)CCC(C)1C=2CCC...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4578 CPD-4578] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C)C(=O)CCC(C)1C=2CCC(C)34)))) |
+ | * inchi key: | ||
+ | ** InChIKey=DBPZYKHQDWKORQ-SINUOACOSA-N | ||
* common name: | * common name: | ||
− | ** 3- | + | ** 3-dehydro-4-methylzymosterol |
− | * | + | * molecular weight: |
− | + | ** 396.655 | |
− | ** | + | |
* Synonym(s): | * Synonym(s): | ||
+ | ** 4α-methyl-5α-cholesta-8,24-dien-3-one | ||
+ | ** 3-keto-4-methylzymosterol | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN66-313]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * LIGAND- | + | * LIGAND-CPD: |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C15816 C15816] |
− | * | + | * CHEBI: |
− | ** [http://www. | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=50593 50593] |
− | + | * METABOLIGHTS : MTBLC50593 | |
− | + | * PUBCHEM: | |
− | * | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=22298939 22298939] |
− | * | + | * HMDB : HMDB06838 |
− | ** [http:// | + | {{#set: smiles=CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C)C(=O)CCC(C)1C=2CCC(C)34))))}} |
− | + | {{#set: inchi key=InChIKey=DBPZYKHQDWKORQ-SINUOACOSA-N}} | |
− | + | {{#set: common name=3-dehydro-4-methylzymosterol}} | |
− | * | + | {{#set: molecular weight=396.655 }} |
− | + | {{#set: common name=4α-methyl-5α-cholesta-8,24-dien-3-one|3-keto-4-methylzymosterol}} | |
− | + | {{#set: produced by=RXN66-313}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + |
Revision as of 18:30, 10 January 2018
Contents
Metabolite CPD-4578
- smiles:
- CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C)C(=O)CCC(C)1C=2CCC(C)34))))
- inchi key:
- InChIKey=DBPZYKHQDWKORQ-SINUOACOSA-N
- common name:
- 3-dehydro-4-methylzymosterol
- molecular weight:
- 396.655
- Synonym(s):
- 4α-methyl-5α-cholesta-8,24-dien-3-one
- 3-keto-4-methylzymosterol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C)C(=O)CCC(C)1C=2CCC(C)34))))" cannot be used as a page name in this wiki.