Difference between revisions of "RXN-11474"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-37 CPDQT-37] == * smiles: ** CSCCCCC(C(O)C(=O)[O-])C(=O)[O-] * inchi key: ** InChIKey=ZIZ...") |
(Created page with "Category:Gene == Gene Tiso_gene_17819 == * left end position: ** 17 * transcription direction: ** NEGATIVE * right end position: ** 2031 * centisome position: ** 0.4941860...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_17819 == |
| − | * | + | * left end position: |
| − | ** | + | ** 17 |
| − | * | + | * transcription direction: |
| − | ** | + | ** NEGATIVE |
| − | * | + | * right end position: |
| − | ** | + | ** 2031 |
| − | * | + | * centisome position: |
| − | ** | + | ** 0.49418607 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == | + | == Reactions associated == |
| − | * [[ | + | * [[RXN-11109]] |
| − | + | ** in-silico_annotation | |
| − | == | + | ***ec-number |
| − | + | ** experimental_annotation | |
| + | ***ec-number | ||
| + | == Pathways associated == | ||
== External links == | == External links == | ||
| − | + | {{#set: left end position=17}} | |
| − | + | {{#set: transcription direction=NEGATIVE}} | |
| − | {{#set: | + | {{#set: right end position=2031}} |
| − | {{#set: | + | {{#set: centisome position=0.49418607 }} |
| − | {{#set: | + | {{#set: reaction associated=RXN-11109}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
Revision as of 17:31, 10 January 2018
Gene Tiso_gene_17819
- left end position:
- 17
- transcription direction:
- NEGATIVE
- right end position:
- 2031
- centisome position:
- 0.49418607
- Synonym(s):
Reactions associated
- RXN-11109
- in-silico_annotation
- ec-number
- experimental_annotation
- ec-number
- in-silico_annotation
