Difference between revisions of "CADAVERINE"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=CEREBROSIDE-SULFATASE-RXN CEREBROSIDE-SULFATASE-RXN] == * direction: ** LEFT-TO-RIGHT * common name...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NN-DIMETHYLANILINE NN-DIMETHYLANILINE] == * smiles: ** CN(C1(C=CC=CC=1))C * inchi key: ** InChI...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NN-DIMETHYLANILINE NN-DIMETHYLANILINE] == |
− | * | + | * smiles: |
− | ** | + | ** CN(C1(C=CC=CC=1))C |
+ | * inchi key: | ||
+ | ** InChIKey=JLTDJTHDQAWBAV-UHFFFAOYSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** N,N-dimethylaniline |
− | * | + | * molecular weight: |
− | ** | + | ** 121.182 |
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[1.14.13.8-RXN]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | * | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * LIGAND- | + | * NCI: |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=7195 7195] |
− | * | + | * PUBCHEM: |
− | ** [http://www. | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=949 949] |
− | ** [http://www. | + | * HMDB : HMDB01020 |
− | {{#set: | + | * LIGAND-CPD: |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?C02846 C02846] | |
− | + | * CHEMSPIDER: | |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.924.html 924] |
− | + | * CHEBI: | |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16269 16269] |
− | {{#set: | + | {{#set: smiles=CN(C1(C=CC=CC=1))C}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=JLTDJTHDQAWBAV-UHFFFAOYSA-N}} |
+ | {{#set: common name=N,N-dimethylaniline}} | ||
+ | {{#set: molecular weight=121.182 }} | ||
+ | {{#set: consumed by=1.14.13.8-RXN}} |
Revision as of 17:31, 10 January 2018
Contents
Metabolite NN-DIMETHYLANILINE
- smiles:
- CN(C1(C=CC=CC=1))C
- inchi key:
- InChIKey=JLTDJTHDQAWBAV-UHFFFAOYSA-N
- common name:
- N,N-dimethylaniline
- molecular weight:
- 121.182
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links