Difference between revisions of "Tiso gene 4160"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_2226 == * left end position: ** 7421 * transcription direction: ** NEGATIVE * right end position: ** 11435 * centisome position: ** 36.9774...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THMPT THMPT] == * smiles: ** CC([CH]1(C(C)NC2(=C(N1)C(NC(=N2)N)=O)))NC4(=CC=C(CC(C(C(COC3(C(C(C...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THMPT THMPT] == |
− | * | + | * smiles: |
− | ** | + | ** CC([CH]1(C(C)NC2(=C(N1)C(NC(=N2)N)=O)))NC4(=CC=C(CC(C(C(COC3(C(C(C(COP([O-])(=O)OC(C([O-])=O)CCC([O-])=O)O3)O)O))O)O)O)C=C4) |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=SCBIBGUJSMHIAI-LHIIQLEZSA-K |
− | * | + | * common name: |
− | ** | + | ** tetrahydromethanopterin |
− | * | + | * molecular weight: |
− | ** | + | ** 773.666 |
* Synonym(s): | * Synonym(s): | ||
+ | ** THMPT | ||
+ | ** 5,6,7,8-tetrahydromethanopterin | ||
+ | ** H4MPT | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-15635]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49791993 49791993] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58103 58103] |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01217 C01217] |
+ | * HMDB : HMDB60403 | ||
+ | {{#set: smiles=CC([CH]1(C(C)NC2(=C(N1)C(NC(=N2)N)=O)))NC4(=CC=C(CC(C(C(COC3(C(C(C(COP([O-])(=O)OC(C([O-])=O)CCC([O-])=O)O3)O)O))O)O)O)C=C4)}} | ||
+ | {{#set: inchi key=InChIKey=SCBIBGUJSMHIAI-LHIIQLEZSA-K}} | ||
+ | {{#set: common name=tetrahydromethanopterin}} | ||
+ | {{#set: molecular weight=773.666 }} | ||
+ | {{#set: common name=THMPT|5,6,7,8-tetrahydromethanopterin|H4MPT}} | ||
+ | {{#set: produced by=RXN-15635}} |
Revision as of 18:31, 10 January 2018
Contents
Metabolite THMPT
- smiles:
- CC([CH]1(C(C)NC2(=C(N1)C(NC(=N2)N)=O)))NC4(=CC=C(CC(C(C(COC3(C(C(C(COP([O-])(=O)OC(C([O-])=O)CCC([O-])=O)O3)O)O))O)O)O)C=C4)
- inchi key:
- InChIKey=SCBIBGUJSMHIAI-LHIIQLEZSA-K
- common name:
- tetrahydromethanopterin
- molecular weight:
- 773.666
- Synonym(s):
- THMPT
- 5,6,7,8-tetrahydromethanopterin
- H4MPT
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC([CH]1(C(C)NC2(=C(N1)C(NC(=N2)N)=O)))NC4(=CC=C(CC(C(C(COC3(C(C(C(COP([O-])(=O)OC(C([O-])=O)CCC([O-])=O)O3)O)O))O)O)O)C=C4)" cannot be used as a page name in this wiki.