Difference between revisions of "CPD-14407"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_19322 == * Synonym(s): == Reactions associated == * 1.14.19.1-RXN ** pantograph-creinhardtii * CY_focytb5_c ** pantograp...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-37 CPDQT-37] == * smiles: ** CSCCCCC(C(O)C(=O)[O-])C(=O)[O-] * inchi key: ** InChIKey=ZIZ...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-37 CPDQT-37] == |
+ | * smiles: | ||
+ | ** CSCCCCC(C(O)C(=O)[O-])C(=O)[O-] | ||
+ | * inchi key: | ||
+ | ** InChIKey=ZIZLDVKLMYVMNX-UHFFFAOYSA-L | ||
+ | * common name: | ||
+ | ** 3-(4'-methylthio)butylmalate | ||
+ | * molecular weight: | ||
+ | ** 234.267 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 3-(4'-methylthio)butylmalic acid | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXNQT-4168]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[RXN-18206]] | |
− | == | + | |
− | * [[ | + | |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237164 44237164] |
+ | {{#set: smiles=CSCCCCC(C(O)C(=O)[O-])C(=O)[O-]}} | ||
+ | {{#set: inchi key=InChIKey=ZIZLDVKLMYVMNX-UHFFFAOYSA-L}} | ||
+ | {{#set: common name=3-(4'-methylthio)butylmalate}} | ||
+ | {{#set: molecular weight=234.267 }} | ||
+ | {{#set: common name=3-(4'-methylthio)butylmalic acid}} | ||
+ | {{#set: consumed by=RXNQT-4168}} | ||
+ | {{#set: consumed or produced by=RXN-18206}} |
Revision as of 17:32, 10 January 2018
Contents
Metabolite CPDQT-37
- smiles:
- CSCCCCC(C(O)C(=O)[O-])C(=O)[O-]
- inchi key:
- InChIKey=ZIZLDVKLMYVMNX-UHFFFAOYSA-L
- common name:
- 3-(4'-methylthio)butylmalate
- molecular weight:
- 234.267
- Synonym(s):
- 3-(4'-methylthio)butylmalic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CSCCCCC(C(O)C(=O)[O-])C(=O)[O-" cannot be used as a page name in this wiki.