Difference between revisions of "CPD-14407"

Revision as of 17:32, 10 January 2018

"CSCCCCC(C(O)C(=O)[O-])C(=O)[O-" cannot be used as a page name in this wiki.

@@ Line 1: / Line 1: @@
-[[Category:Gene]]
+[[Category:Metabolite]]
-== Gene Tiso_gene_19322 ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-37 CPDQT-37] ==
+* smiles:
+** CSCCCCC(C(O)C(=O)[O-])C(=O)[O-]
+* inchi key:
+** InChIKey=ZIZLDVKLMYVMNX-UHFFFAOYSA-L
+* common name:
+** 3-(4'-methylthio)butylmalate
+* molecular weight:
+** 234.267
 * Synonym(s):
+** 3-(4'-methylthio)butylmalic acid
-== Reactions associated ==
+== Reaction(s) known to consume the compound ==
-* [[1.14.19.1-RXN]]
+* [[RXNQT-4168]]
-** [[pantograph]]-[[creinhardtii]]
+== Reaction(s) known to produce the compound ==
-* [[CY_focytb5_c]]
+== Reaction(s) of unknown directionality ==
-** [[pantograph]]-[[creinhardtii]]
+* [[RXN-18206]]
-== Pathways associated ==
-* [[PWY-5996]]
 == External links  ==
-{{#set: reaction associated=1.14.19.1-RXN|CY_focytb5_c}}
+* PUBCHEM:
-{{#set: pathway associated=PWY-5996}}
+** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237164 44237164]
+{{#set: smiles=CSCCCCC(C(O)C(=O)[O-])C(=O)[O-]}}
+{{#set: inchi key=InChIKey=ZIZLDVKLMYVMNX-UHFFFAOYSA-L}}
+{{#set: common name=3-(4'-methylthio)butylmalate}}
+{{#set: molecular weight=234.267    }}
+{{#set: common name=3-(4'-methylthio)butylmalic acid}}
+{{#set: consumed by=RXNQT-4168}}
+{{#set: consumed or produced by=RXN-18206}}