Difference between revisions of "Tiso gene 18988"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8120 CPD-8120] == * smiles: ** CCCCCC=CCC=CCC=CCCCCCCC(=O)[O-] * inchi key: ** InChIKey=HOB...") |
(Created page with "Category:Gene == Gene Tiso_gene_14485 == * left end position: ** 2851 * transcription direction: ** NEGATIVE * right end position: ** 5579 * centisome position: ** 50.7747...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_14485 == |
− | * | + | * left end position: |
− | ** | + | ** 2851 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 5579 |
− | * | + | * centisome position: |
− | ** | + | ** 50.77471 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * [[2.3.1.179-RXN]] | |
− | * [[RXN- | + | ** in-silico_annotation |
− | == | + | ***ec-number |
+ | ** experimental_annotation | ||
+ | ***ec-number | ||
+ | * [[2.3.1.41-RXN]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[3-OXOACYL-ACP-SYNTH-BASE-RXN]] | ||
+ | ** [[pantograph]]-[[synechocystis]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[3-OXOACYL-ACP-SYNTH-RXN]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN-10059]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN-10654]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN-10658]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN-11474]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN-11479]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN-8391]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | ** experimental_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN-9516]] | ||
+ | ** [[pantograph]]-[[synechocystis]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN-9523]] | ||
+ | ** [[pantograph]]-[[synechocystis]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN-9527]] | ||
+ | ** [[pantograph]]-[[synechocystis]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN-9531]] | ||
+ | ** [[pantograph]]-[[synechocystis]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN-9535]] | ||
+ | ** [[pantograph]]-[[synechocystis]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN-9539]] | ||
+ | ** [[pantograph]]-[[synechocystis]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN-9632]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN-9648]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN-9650]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN-9651]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN-9652]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN-9653]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN-9654]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN1G-1003]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN1G-132]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN1G-138]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN1G-218]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN1G-236]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN1G-26]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN1G-306]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN1G-324]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN1G-368]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN1G-445]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN1G-460]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN1G-499]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN1G-840]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN3O-1803]] | ||
+ | ** [[pantograph]]-[[athaliana]] | ||
+ | ** [[pantograph]]-[[synechocystis]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-6113]] | ||
+ | * [[FASYN-ELONG-PWY]] | ||
+ | * [[PWY-6519]] | ||
+ | * [[PWY-7388]] | ||
+ | * [[PWY-5367]] | ||
+ | * [[PWY-5971]] | ||
+ | * [[PWY-6282]] | ||
+ | * [[PWY-5965]] | ||
+ | * [[PWY-5973]] | ||
+ | * [[PWY-5989]] | ||
+ | * [[PWY-5966]] | ||
+ | * [[PWYG-321]] | ||
+ | * [[FASYN-INITIAL-PWY]] | ||
+ | * [[PWY-5994]] | ||
+ | * [[PWY3O-355]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=2851}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=5579}} | |
− | + | {{#set: centisome position=50.77471 }} | |
− | + | {{#set: reaction associated=2.3.1.179-RXN|2.3.1.41-RXN|3-OXOACYL-ACP-SYNTH-BASE-RXN|3-OXOACYL-ACP-SYNTH-RXN|RXN-10059|RXN-10654|RXN-10658|RXN-11474|RXN-11479|RXN-8391|RXN-9516|RXN-9523|RXN-9527|RXN-9531|RXN-9535|RXN-9539|RXN-9632|RXN-9648|RXN-9650|RXN-9651|RXN-9652|RXN-9653|RXN-9654|RXN1G-1003|RXN1G-132|RXN1G-138|RXN1G-218|RXN1G-236|RXN1G-26|RXN1G-306|RXN1G-324|RXN1G-368|RXN1G-445|RXN1G-460|RXN1G-499|RXN1G-840|RXN3O-1803}} | |
− | + | {{#set: pathway associated=PWY-6113|FASYN-ELONG-PWY|PWY-6519|PWY-7388|PWY-5367|PWY-5971|PWY-6282|PWY-5965|PWY-5973|PWY-5989|PWY-5966|PWYG-321|FASYN-INITIAL-PWY|PWY-5994|PWY3O-355}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 17:32, 10 January 2018
Gene Tiso_gene_14485
- left end position:
- 2851
- transcription direction:
- NEGATIVE
- right end position:
- 5579
- centisome position:
- 50.77471
- Synonym(s):
Reactions associated
- 2.3.1.179-RXN
- in-silico_annotation
- ec-number
- experimental_annotation
- ec-number
- in-silico_annotation
- 2.3.1.41-RXN
- 3-OXOACYL-ACP-SYNTH-BASE-RXN
- 3-OXOACYL-ACP-SYNTH-RXN
- RXN-10059
- RXN-10654
- RXN-10658
- RXN-11474
- RXN-11479
- RXN-8391
- in-silico_annotation
- ec-number
- experimental_annotation
- ec-number
- in-silico_annotation
- RXN-9516
- RXN-9523
- RXN-9527
- RXN-9531
- RXN-9535
- RXN-9539
- RXN-9632
- RXN-9648
- RXN-9650
- RXN-9651
- RXN-9652
- RXN-9653
- RXN-9654
- RXN1G-1003
- RXN1G-132
- RXN1G-138
- RXN1G-218
- RXN1G-236
- RXN1G-26
- RXN1G-306
- RXN1G-324
- RXN1G-368
- RXN1G-445
- RXN1G-460
- RXN1G-499
- RXN1G-840
- RXN3O-1803
Pathways associated
- PWY-6113
- FASYN-ELONG-PWY
- PWY-6519
- PWY-7388
- PWY-5367
- PWY-5971
- PWY-6282
- PWY-5965
- PWY-5973
- PWY-5989
- PWY-5966
- PWYG-321
- FASYN-INITIAL-PWY
- PWY-5994
- PWY3O-355