Difference between revisions of "CPD-5661"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7004 CPD-7004] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCC=C(C)CCC=C...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ATIDm ATIDm] == * direction: ** LEFT-TO-RIGHT * common name: ** ATP:IDP phosphotransferase, mitocho...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7004 CPD-7004] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ATIDm ATIDm] ==
* smiles:
+
* direction:
** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCC=C(C)CCC=C(C)C)C5(=[N+]([Mg--]36([N+]1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=QHUCPLMRABCZRD-USXFXJNZSA-M
+
 
* common name:
 
* common name:
** dihydrogeranylgeranyl chlorophyll a
+
** ATP:IDP phosphotransferase, mitochondria
* molecular weight:
+
** 888.463   
+
 
* Synonym(s):
 
* Synonym(s):
** dihydrogeranylgeranyl-chl a
 
** dihydroGG-chl a
 
** dihydroGG-chlorophyll a
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-7665]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1.0 [[IDP]][m] '''+''' 1.0 [[ATP]][m] '''=>''' 1.0 [[ADP]][m] '''+''' 1.0 [[ITP]][m]
* [[RXN-7664]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1.0 IDP[m] '''+''' 1.0 ATP[m] '''=>''' 1.0 ADP[m] '''+''' 1.0 ITP[m]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_16529]]
 +
** [[pantograph]]-[[creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* [[orthology]]:
 +
** [[pantograph]]:
 +
*** [[creinhardtii]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46926294 46926294]
+
{{#set: common name=ATP:IDP phosphotransferase, mitochondria}}
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCC=C(C)CCC=C(C)C)C5(=[N+]([Mg--]36([N+]1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
+
{{#set: gene associated=Tiso_gene_16529}}
{{#set: inchi key=InChIKey=QHUCPLMRABCZRD-USXFXJNZSA-M}}
+
{{#set: in pathway=}}
{{#set: common name=dihydrogeranylgeranyl chlorophyll a}}
+
{{#set: reconstruction category=orthology}}
{{#set: molecular weight=888.463    }}
+
{{#set: reconstruction tool=pantograph}}
{{#set: common name=dihydrogeranylgeranyl-chl a|dihydroGG-chl a|dihydroGG-chlorophyll a}}
+
{{#set: reconstruction source=creinhardtii}}
{{#set: consumed by=RXN-7665}}
+
{{#set: produced by=RXN-7664}}
+

Revision as of 18:32, 10 January 2018

Reaction ATIDm

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • ATP:IDP phosphotransferase, mitochondria
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 IDP[m] + 1.0 ATP[m] => 1.0 ADP[m] + 1.0 ITP[m]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links