Difference between revisions of "Tiso gene 12875"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1108 CPD-1108] == * common name: ** a 1-phosphatidyl-1D-myo-inositol 4-phosphate * Synonym(...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7004 CPD-7004] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCC=C(C)CCC=C...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7004 CPD-7004] == |
| + | * smiles: | ||
| + | ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCC=C(C)CCC=C(C)C)C5(=[N+]([Mg--]36([N+]1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9)))) | ||
| + | * inchi key: | ||
| + | ** InChIKey=QHUCPLMRABCZRD-USXFXJNZSA-M | ||
* common name: | * common name: | ||
| − | ** a | + | ** dihydrogeranylgeranyl chlorophyll a |
| + | * molecular weight: | ||
| + | ** 888.463 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** dihydrogeranylgeranyl-chl a |
| − | ** | + | ** dihydroGG-chl a |
| + | ** dihydroGG-chlorophyll a | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-7665]] |
| − | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-7664]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46926294 46926294] |
| − | {{#set: consumed by=RXN- | + | {{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCC=C(C)CCC=C(C)C)C5(=[N+]([Mg--]36([N+]1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}} |
| − | {{#set: produced by= | + | {{#set: inchi key=InChIKey=QHUCPLMRABCZRD-USXFXJNZSA-M}} |
| + | {{#set: common name=dihydrogeranylgeranyl chlorophyll a}} | ||
| + | {{#set: molecular weight=888.463 }} | ||
| + | {{#set: common name=dihydrogeranylgeranyl-chl a|dihydroGG-chl a|dihydroGG-chlorophyll a}} | ||
| + | {{#set: consumed by=RXN-7665}} | ||
| + | {{#set: produced by=RXN-7664}} | ||
Revision as of 17:33, 10 January 2018
Contents
Metabolite CPD-7004
- smiles:
- C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCC=C(C)CCC=C(C)C)C5(=[N+]([Mg--]36([N+]1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
- inchi key:
- InChIKey=QHUCPLMRABCZRD-USXFXJNZSA-M
- common name:
- dihydrogeranylgeranyl chlorophyll a
- molecular weight:
- 888.463
- Synonym(s):
- dihydrogeranylgeranyl-chl a
- dihydroGG-chl a
- dihydroGG-chlorophyll a
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCC=C(C)CCC=C(C)C)C5(=[N+]([Mg--]36([N+]1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))" cannot be used as a page name in this wiki.
