Difference between revisions of "CPD-1108"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=a-2-oxoglutarate-dehydrogenase-E2-protei a-2-oxoglutarate-dehydrogenase-E2-protei] == * common...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DAMP DAMP] == * smiles: ** C(C3(C(CC(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O))OP([O-])([O-])=O * inchi...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DAMP DAMP] == |
| + | * smiles: | ||
| + | ** C(C3(C(CC(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O))OP([O-])([O-])=O | ||
| + | * inchi key: | ||
| + | ** InChIKey=KHWCHTKSEGGWEX-RRKCRQDMSA-L | ||
* common name: | * common name: | ||
| − | ** | + | ** dAMP |
| + | * molecular weight: | ||
| + | ** 329.208 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 2'-deoxyadenosine 5'-phosphate | ||
| + | ** deoxyadenosine-phosphate | ||
| + | ** 2'-deoxyadenosine 5''-monophosphate | ||
| + | ** 2'-dAMP | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[DEOXYADENYLATE-KINASE-RXN]] |
| + | * [[ATDAM]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-14195]] | ||
| + | * [[DAD2PT]] | ||
| + | * [[RXN-14215]] | ||
| + | * [[RXN0-384]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[DAMPH]] | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CAS : 653-63-4 |
| − | {{#set: consumed by=RXN- | + | * METABOLIGHTS : MTBLC58245 |
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=22848660 22848660] | ||
| + | * HMDB : HMDB00905 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00360 C00360] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.18735032.html 18735032] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58245 58245] | ||
| + | * BIGG : damp | ||
| + | {{#set: smiles=C(C3(C(CC(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O))OP([O-])([O-])=O}} | ||
| + | {{#set: inchi key=InChIKey=KHWCHTKSEGGWEX-RRKCRQDMSA-L}} | ||
| + | {{#set: common name=dAMP}} | ||
| + | {{#set: molecular weight=329.208 }} | ||
| + | {{#set: common name=2'-deoxyadenosine 5'-phosphate|deoxyadenosine-phosphate|2'-deoxyadenosine 5''-monophosphate|2'-dAMP}} | ||
| + | {{#set: consumed by=DEOXYADENYLATE-KINASE-RXN|ATDAM}} | ||
| + | {{#set: produced by=RXN-14195|DAD2PT|RXN-14215|RXN0-384}} | ||
| + | {{#set: consumed or produced by=DAMPH}} | ||
Revision as of 17:33, 10 January 2018
Contents
Metabolite DAMP
- smiles:
- C(C3(C(CC(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O))OP([O-])([O-])=O
- inchi key:
- InChIKey=KHWCHTKSEGGWEX-RRKCRQDMSA-L
- common name:
- dAMP
- molecular weight:
- 329.208
- Synonym(s):
- 2'-deoxyadenosine 5'-phosphate
- deoxyadenosine-phosphate
- 2'-deoxyadenosine 5-monophosphate
- 2'-dAMP
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 653-63-4
- METABOLIGHTS : MTBLC58245
- PUBCHEM:
- HMDB : HMDB00905
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- BIGG : damp
"C(C3(C(CC(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O))OP([O-])([O-])=O" cannot be used as a page name in this wiki.
