Difference between revisions of "Trans-D2-hexacos-2-enoyl-ACPs"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACETYL-GLU ACETYL-GLU] == * smiles: ** CC(=O)NC(C([O-])=O)CCC(=O)[O-] * inchi key: ** InChIKey=...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXY-FERULIC-ACID 5-HYDROXY-FERULIC-ACID] == * smiles: ** COC1(C=C(C=CC([O-])=O)C=C(O)C(O)...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXY-FERULIC-ACID 5-HYDROXY-FERULIC-ACID] == |
* smiles: | * smiles: | ||
− | ** | + | ** COC1(C=C(C=CC([O-])=O)C=C(O)C(O)=1) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=YFXWTVLDSKSYLW-NSCUHMNNSA-M |
* common name: | * common name: | ||
− | ** | + | ** 5-hydroxyferulate |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 209.178 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 5-hydroxy ferulic acid |
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-3422]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-1121]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
− | |||
== External links == | == External links == | ||
− | |||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54740354 54740354] |
− | + | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05619 C05619] |
− | * | + | * HMDB : HMDB35484 |
− | + | {{#set: smiles=COC1(C=C(C=CC([O-])=O)C=C(O)C(O)=1)}} | |
− | + | {{#set: inchi key=InChIKey=YFXWTVLDSKSYLW-NSCUHMNNSA-M}} | |
− | + | {{#set: common name=5-hydroxyferulate}} | |
− | + | {{#set: molecular weight=209.178 }} | |
− | {{#set: smiles= | + | {{#set: common name=5-hydroxy ferulic acid}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: consumed by=RXN-3422}} |
− | {{#set: common name= | + | {{#set: produced by=RXN-1121}} |
− | {{#set: molecular weight= | + | |
− | {{#set: common name= | + | |
− | {{#set: consumed by= | + | |
− | + | ||
− | {{#set: | + |
Revision as of 17:33, 10 January 2018
Contents
Metabolite 5-HYDROXY-FERULIC-ACID
- smiles:
- COC1(C=C(C=CC([O-])=O)C=C(O)C(O)=1)
- inchi key:
- InChIKey=YFXWTVLDSKSYLW-NSCUHMNNSA-M
- common name:
- 5-hydroxyferulate
- molecular weight:
- 209.178
- Synonym(s):
- 5-hydroxy ferulic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"COC1(C=C(C=CC([O-])=O)C=C(O)C(O)=1)" cannot be used as a page name in this wiki.