Difference between revisions of "RXN-7607"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7850 CPD-7850] == * smiles: ** CC(=CC=CC=C(C=CC=C(C=CC1(C(CCC(C=1C)=O)(C)C))C)C)C=CC=C(C)C=...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-336 RXN66-336] == * direction: ** LEFT-TO-RIGHT * common name: ** leukotriene-C4 gamma-glutam...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7850 CPD-7850] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-336 RXN66-336] ==
* smiles:
+
* direction:
** CC(=CC=CC=C(C=CC=C(C=CC1(C(CCC(C=1C)=O)(C)C))C)C)C=CC=C(C)C=CC2(=C(CCCC2(C)C)C)
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=QXNWZXMBUKUYMD-QQGJMDNJSA-N
+
 
* common name:
 
* common name:
** echinenone
+
** leukotriene-C4 gamma-glutamyl transferase
* molecular weight:
+
** gamma-glutamyl_transferase
** 550.866   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/2.3.2.2 EC-2.3.2.2]
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[R07562]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[LEUKOTRIENE-C4]][c] '''+''' 1 [[Amino-Acids-20]][c] '''=>''' 1 [[CPD66-21]][c] '''+''' 1 [[5-L-GLUTAMYL-L-AMINO-ACID]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 leukotriene-C4[c] '''+''' 1 a proteinogenic amino acid[c] '''=>''' 1 leukotriene-D4[c] '''+''' 1 an (γ-L-glutamyl)-L-amino acid[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_12321]]
 +
** IN-SILICO_ANNOTATION
 +
***AUTOMATED-NAME-MATCH
 +
** [[pantograph]]-[[esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY66-375]], leukotriene biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-375 PWY66-375]
 +
** '''2''' reactions found over '''6''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* [[orthology]]:
 +
** [[pantograph]]:
 +
*** [[esiliculosus]]
 +
* [[annotation]]:
 +
** [[pathwaytools]]:
 +
*** [[in-silico_annotation]]
 
== External links  ==
 
== External links  ==
* LIPID_MAPS : LMPR01070060
+
{{#set: direction=LEFT-TO-RIGHT}}
* PUBCHEM:
+
{{#set: common name=leukotriene-C4 gamma-glutamyl transferase}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5281236 5281236]
+
{{#set: common name=gamma-glutamyl_transferase}}
* CHEMSPIDER:
+
{{#set: ec number=EC-2.3.2.2}}
** [http://www.chemspider.com/Chemical-Structure.4444648.html 4444648]
+
{{#set: gene associated=Tiso_gene_12321}}
* CHEBI:
+
{{#set: in pathway=PWY66-375}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=4746 4746]
+
{{#set: reconstruction category=orthology}}
* LIGAND-CPD:
+
{{#set: reconstruction tool=pantograph}}
** [http://www.genome.jp/dbget-bin/www_bget?C08592 C08592]
+
{{#set: reconstruction source=esiliculosus}}
{{#set: smiles=CC(=CC=CC=C(C=CC=C(C=CC1(C(CCC(C=1C)=O)(C)C))C)C)C=CC=C(C)C=CC2(=C(CCCC2(C)C)C)}}
+
{{#set: reconstruction category=annotation}}
{{#set: inchi key=InChIKey=QXNWZXMBUKUYMD-QQGJMDNJSA-N}}
+
{{#set: reconstruction tool=pathwaytools}}
{{#set: common name=echinenone}}
+
{{#set: reconstruction source=in-silico_annotation}}
{{#set: molecular weight=550.866    }}
+
{{#set: consumed by=R07562}}
+

Revision as of 17:33, 10 January 2018

Reaction RXN66-336

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • leukotriene-C4 gamma-glutamyl transferase
    • gamma-glutamyl_transferase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY66-375, leukotriene biosynthesis: PWY66-375
    • 2 reactions found over 6 reactions in the full pathway

Reconstruction information

External links