Difference between revisions of "Tiso gene 9916"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=SPHINGANINE-KINASE-RXN SPHINGANINE-KINASE-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [ht...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19172 CPD-19172] == * smiles: ** CCCCCCCCC=CCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19172 CPD-19172] == |
| − | * | + | * smiles: |
| − | ** | + | ** CCCCCCCCC=CCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=REOYMONHGHULEY-PPSVNWDXSA-J |
| + | * common name: | ||
| + | ** (2E,9Z)-octadecenoyl-CoA | ||
| + | * molecular weight: | ||
| + | ** 1025.937 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 18:2-Δ2,Δ9-CoA | ||
| + | ** 2-trans,9-cis-octadecenoyl-CoA | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-17775]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | = | + | |
| − | + | ||
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | {{#set: smiles=CCCCCCCCC=CCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | |
| − | + | {{#set: inchi key=InChIKey=REOYMONHGHULEY-PPSVNWDXSA-J}} | |
| − | + | {{#set: common name=(2E,9Z)-octadecenoyl-CoA}} | |
| − | + | {{#set: molecular weight=1025.937 }} | |
| − | {{#set: | + | {{#set: common name=18:2-Δ2,Δ9-CoA|2-trans,9-cis-octadecenoyl-CoA}} |
| − | {{#set: | + | {{#set: produced by=RXN-17775}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
Revision as of 17:33, 10 January 2018
Contents
Metabolite CPD-19172
- smiles:
- CCCCCCCCC=CCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=REOYMONHGHULEY-PPSVNWDXSA-J
- common name:
- (2E,9Z)-octadecenoyl-CoA
- molecular weight:
- 1025.937
- Synonym(s):
- 18:2-Δ2,Δ9-CoA
- 2-trans,9-cis-octadecenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCCCC=CCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
