Difference between revisions of "Tiso gene 5525"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7005 CPD-7005] == * smiles: ** C=CC2(=C(C)C5(=CC1(C(C)C(CCC(=O)OCC=C(C)CCC=C(C)CCC=C(C)CCC=...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ATAMm ATAMm] == * direction: ** LEFT-TO-RIGHT * common name: ** ATP:AMP phosphotransferase, mitocho...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7005 CPD-7005] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ATAMm ATAMm] ==
−
* smiles:
+
* direction:
−
** C=CC2(=C(C)C5(=CC1(C(C)C(CCC(=O)OCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)C(N=1)=C7([C-](C(OC)=O)C(=O)C6(C(C)=C4(N([Mg]N(C2=CC3(C(C)=C(CC)C(N=3)=C4))5)C=67))))))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=QBLSEPRESQJTCI-ZNLWZYPOSA-M
+
 
* common name:
 
* common name:
−
** geranylgeranyl chlorophyll a
+
** ATP:AMP phosphotransferase, mitochondria
−
* molecular weight:
+
−
** 886.447   
+
 
* Synonym(s):
 
* Synonym(s):
−
** geranylgeranyl-chl a
 
−
** GG-chl a
 
−
** GG-chlorophyll a
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-7664]]
+
* With identifiers:
−
* [[RXN-17428]]
+
** 1.0 [[AMP]][m] '''+''' 1.0 [[ATP]][m] '''=>''' 2.0 [[ADP]][m]
−
== Reaction(s) known to produce the compound ==
+
* With common name(s):
−
* [[RXN-7663]]
+
** 1.0 AMP[m] '''+''' 1.0 ATP[m] '''=>''' 2.0 ADP[m]
−
== Reaction(s) of unknown directionality ==
+
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_5837]]
 +
** [[pantograph]]-[[creinhardtii]]
 +
* [[Tiso_gene_5839]]
 +
** [[pantograph]]-[[creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* [[orthology]]:
 +
** [[pantograph]]:
 +
*** [[creinhardtii]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657538 90657538]
+
{{#set: common name=ATP:AMP phosphotransferase, mitochondria}}
−
* CHEBI:
+
{{#set: gene associated=Tiso_gene_5837|Tiso_gene_5839}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64668 64668]
+
{{#set: in pathway=}}
−
{{#set: smiles=C=CC2(=C(C)C5(=CC1(C(C)C(CCC(=O)OCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)C(N=1)=C7([C-](C(OC)=O)C(=O)C6(C(C)=C4(N([Mg]N(C2=CC3(C(C)=C(CC)C(N=3)=C4))5)C=67))))))}}
+
{{#set: reconstruction category=orthology}}
−
{{#set: inchi key=InChIKey=QBLSEPRESQJTCI-ZNLWZYPOSA-M}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: common name=geranylgeranyl chlorophyll a}}
+
{{#set: reconstruction source=creinhardtii}}
−
{{#set: molecular weight=886.447    }}
+
−
{{#set: common name=geranylgeranyl-chl a|GG-chl a|GG-chlorophyll a}}
+
−
{{#set: consumed by=RXN-7664|RXN-17428}}
+
−
{{#set: produced by=RXN-7663}}
+

Revision as of 17:34, 10 January 2018

Reaction ATAMm

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • ATP:AMP phosphotransferase, mitochondria
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 AMP[m] + 1.0 ATP[m] => 2.0 ADP[m]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_5525&oldid=18442"