Difference between revisions of "Ribulose-phosphates"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LYS LYS] == * smiles: ** C([N+])CCCC([N+])C([O-])=O * inchi key: ** InChIKey=KDXKERNSBIXSRK-YFK...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TARTRONATE-S-ALD TARTRONATE-S-ALD] == * smiles: ** [CH](=O)C(O)C(=O)[O-] * inchi key: ** InChIK...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TARTRONATE-S-ALD TARTRONATE-S-ALD] == |
* smiles: | * smiles: | ||
| − | ** | + | ** [CH](=O)C(O)C(=O)[O-] |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=QWBAFPFNGRFSFB-UHFFFAOYSA-M |
* common name: | * common name: | ||
| − | ** | + | ** tartronate semialdehyde |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 103.054 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 2-hydroxy-3-oxopropanoate |
| − | + | ** tartronic semialdehyde | |
| − | + | ** hydroxymalonaldehydic acid | |
| − | ** | + | ** tartronate-S-ald |
| − | ** | + | |
| − | ** | + | |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[R01747]] |
| − | + | ||
| − | + | ||
| − | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN0-5289]] | ||
| + | * [[RXN0-305]] | ||
| + | * [[4.1.2.20-RXN]] | ||
| + | * [[KDGALDOL-RXN]] | ||
== External links == | == External links == | ||
| − | * CAS : | + | * CAS : 2480-77-5 |
| − | + | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=22134427 22134427] |
| − | * HMDB : | + | * HMDB : HMDB06938 |
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01146 C01146] |
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57978 57978] |
| − | * BIGG : | + | * BIGG : 2h3oppan |
| − | + | {{#set: smiles=[CH](=O)C(O)C(=O)[O-]}} | |
| − | {{#set: smiles= | + | {{#set: inchi key=InChIKey=QWBAFPFNGRFSFB-UHFFFAOYSA-M}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: common name=tartronate semialdehyde}} |
| − | {{#set: common name= | + | {{#set: molecular weight=103.054 }} |
| − | {{#set: molecular weight= | + | {{#set: common name=2-hydroxy-3-oxopropanoate|tartronic semialdehyde|hydroxymalonaldehydic acid|tartronate-S-ald}} |
| − | {{#set: common name= | + | {{#set: consumed by=R01747}} |
| − | {{#set: consumed by= | + | {{#set: consumed or produced by=RXN0-5289|RXN0-305|4.1.2.20-RXN|KDGALDOL-RXN}} |
| − | {{#set: produced by= | + | |
Revision as of 17:35, 10 January 2018
Contents
Metabolite TARTRONATE-S-ALD
- smiles:
- [CH](=O)C(O)C(=O)[O-]
- inchi key:
- InChIKey=QWBAFPFNGRFSFB-UHFFFAOYSA-M
- common name:
- tartronate semialdehyde
- molecular weight:
- 103.054
- Synonym(s):
- 2-hydroxy-3-oxopropanoate
- tartronic semialdehyde
- hydroxymalonaldehydic acid
- tartronate-S-ald
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CH](=O)C(O)C(=O)[O-" cannot be used as a page name in this wiki.
