Difference between revisions of "N-Ac-L-methionyl-L-glutaminyl-Protein"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DTTGY DTTGY] == * direction: ** LEFT-TO-RIGHT * common name: ** dTTP:cytidine 5'-phosphotransferase...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-RIBULOSE-5-P L-RIBULOSE-5-P] == * smiles: ** C(OP(=O)([O-])[O-])C(O)C(O)C(=O)CO * inchi key:...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=DTTGY DTTGY] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-RIBULOSE-5-P L-RIBULOSE-5-P] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(OP(=O)([O-])[O-])C(O)C(O)C(=O)CO
 +
* inchi key:
 +
** InChIKey=FNZLKVNUWIIPSJ-CRCLSJGQSA-L
 
* common name:
 
* common name:
−
** dTTP:cytidine 5'-phosphotransferase
+
** L-ribulose 5-phosphate
 +
* molecular weight:
 +
** 228.095   
 
* Synonym(s):
 
* Synonym(s):
 +
** L-ribulose-5-P
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1.0 [[TTP]][c] '''+''' 1.0 [[CYTIDINE]][c] '''=>''' 1.0 [[PROTON]][c] '''+''' 1.0 [[CYTIDINE]][c] '''+''' 1.0 [[CMP]][c]
+
* [[RXN0-5116]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1.0 dTTP[c] '''+''' 1.0 cytidine[c] '''=>''' 1.0 H+[c] '''+''' 1.0 cytidine[c] '''+''' 1.0 CMP[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_14474]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
* [[Tiso_gene_20134]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[creinhardtii]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* CAS : 2922-69-2
−
{{#set: common name=dTTP:cytidine 5'-phosphotransferase}}
+
* PUBCHEM:
−
{{#set: gene associated=Tiso_gene_14474|Tiso_gene_20134}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21145006 21145006]
−
{{#set: in pathway=}}
+
* LIGAND-CPD:
−
{{#set: reconstruction category=orthology}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C01101 C01101]
−
{{#set: reconstruction tool=pantograph}}
+
* CHEMSPIDER:
−
{{#set: reconstruction source=creinhardtii}}
+
** [http://www.chemspider.com/Chemical-Structure.20015750.html 20015750]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58226 58226]
 +
* BIGG : ru5p__L
 +
{{#set: smiles=C(OP(=O)([O-])[O-])C(O)C(O)C(=O)CO}}
 +
{{#set: inchi key=InChIKey=FNZLKVNUWIIPSJ-CRCLSJGQSA-L}}
 +
{{#set: common name=L-ribulose 5-phosphate}}
 +
{{#set: molecular weight=228.095    }}
 +
{{#set: common name=L-ribulose-5-P}}
 +
{{#set: produced by=RXN0-5116}}

Revision as of 17:35, 10 January 2018

Metabolite L-RIBULOSE-5-P

  • smiles:
    • C(OP(=O)([O-])[O-])C(O)C(O)C(=O)CO
  • inchi key:
    • InChIKey=FNZLKVNUWIIPSJ-CRCLSJGQSA-L
  • common name:
    • L-ribulose 5-phosphate
  • molecular weight:
    • 228.095
  • Synonym(s):
    • L-ribulose-5-P

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(OP(=O)([O-])[O-])C(O)C(O)C(=O)CO" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=N-Ac-L-methionyl-L-glutaminyl-Protein&oldid=18540"