Difference between revisions of "CPD-4586"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-LACTOYL-GLUTATHIONE S-LACTOYL-GLUTATHIONE] == * smiles: ** CC(O)C(=O)SCC(C(NCC([O-])=O)=O)NC(...")
 
(Created page with "Category:Gene == Gene Tiso_gene_4437 == * left end position: ** 1933 * transcription direction: ** POSITIVE * right end position: ** 8671 * centisome position: ** 13.01070...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-LACTOYL-GLUTATHIONE S-LACTOYL-GLUTATHIONE] ==
+
== Gene Tiso_gene_4437 ==
−
* smiles:
+
* left end position:
−
** CC(O)C(=O)SCC(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O
+
** 1933
−
* inchi key:
+
* transcription direction:
−
** InChIKey=VDYDCVUWILIYQF-CSMHCCOUSA-M
+
** POSITIVE
−
* common name:
+
* right end position:
−
** (R)-S-lactoylglutathione
+
** 8671
−
* molecular weight:
+
* centisome position:
−
** 378.376    
+
** 13.010701    
 
* Synonym(s):
 
* Synonym(s):
−
** S-D-lactoylglutathione
 
−
** D-lactoylglutathione
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[GLYOXII-RXN]]
+
* [[ATPASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** in-silico_annotation
−
== Reaction(s) of unknown directionality ==
+
***ec-number
−
* [[GLYOXI-RXN]]
+
* [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
 +
** in-silico_annotation
 +
***ec-number
 +
* [[RXN-12195]]
 +
** in-silico_annotation
 +
***ec-number
 +
* [[RXN-12196]]
 +
** in-silico_annotation
 +
***ec-number
 +
* [[RXN0-5462]]
 +
** in-silico_annotation
 +
***ec-number
 +
== Pathways associated ==
 +
* [[PWY-7184]]
 +
* [[PWY-7198]]
 +
* [[PWY-6545]]
 +
* [[PWY-7210]]
 
== External links  ==
 
== External links  ==
−
* CAS : 25138-66-3
+
{{#set: left end position=1933}}
−
* PUBCHEM:
+
{{#set: transcription direction=POSITIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878377 46878377]
+
{{#set: right end position=8671}}
−
* HMDB : HMDB01066
+
{{#set: centisome position=13.010701   }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=ATPASE-RXN|NUCLEOSIDE-TRIPHOSPHATASE-RXN|RXN-12195|RXN-12196|RXN0-5462}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C03451 C03451]
+
{{#set: pathway associated=PWY-7184|PWY-7198|PWY-6545|PWY-7210}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57474 57474]
+
−
* BIGG : lgt__S
+
−
{{#set: smiles=CC(O)C(=O)SCC(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O}}
+
−
{{#set: inchi key=InChIKey=VDYDCVUWILIYQF-CSMHCCOUSA-M}}
+
−
{{#set: common name=(R)-S-lactoylglutathione}}
+
−
{{#set: molecular weight=378.376   }}
+
−
{{#set: common name=S-D-lactoylglutathione|D-lactoylglutathione}}
+
−
{{#set: consumed by=GLYOXII-RXN}}
+
−
{{#set: consumed or produced by=GLYOXI-RXN}}
+

Revision as of 17:35, 10 January 2018

Gene Tiso_gene_4437

  • left end position:
    • 1933
  • transcription direction:
    • POSITIVE
  • right end position:
    • 8671
  • centisome position:
    • 13.010701
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-4586&oldid=18544"