Difference between revisions of "RIBITOL-2-DEHYDROGENASE-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14280 RXN-14280] == * direction: ** REVERSIBLE * common name: ** perillyl aldehyde dehydrogenas...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-464 CPD-464] == * smiles: ** CC(=CCCC(=CCCC(=CCCC(=CC1(C(CCC=C(CCC=C(CCC=C(C)C)C)C)(C1COP(O...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14280 RXN-14280] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-464 CPD-464] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** CC(=CCCC(=CCCC(=CCCC(=CC1(C(CCC=C(CCC=C(CCC=C(C)C)C)C)(C1COP(OP(=O)([O-])[O-])([O-])=O)C))C)C)C)C
 +
* inchi key:
 +
** InChIKey=RVCNKTPCHZNAAO-IMSLGMFESA-K
 
* common name:
 
* common name:
−
** perillyl aldehyde dehydrogenase
+
** prephytoene diphosphate
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/1.2.1.3 EC-1.2.1.3]
+
** 719.897   
 
* Synonym(s):
 
* Synonym(s):
 +
** (1R,2R,3R)-prephytoene diphosphate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXNARA-8002]]
−
** 1 [[WATER]][c] '''+''' 1 [[CPD-1084]][c] '''+''' 1 [[NAD]][c] '''<=>''' 2 [[PROTON]][c] '''+''' 1 [[CPD-12443]][c] '''+''' 1 [[NADH]][c]
+
* [[RXN-12245]]
−
* With common name(s):
+
== Reaction(s) known to produce the compound ==
−
** 1 H2O[c] '''+''' 1 perillyl aldehyde[c] '''+''' 1 NAD+[c] '''<=>''' 2 H+[c] '''+''' 1 perillate[c] '''+''' 1 NADH[c]
+
* [[2.5.1.32-RXN]]
−
 
+
== Reaction(s) of unknown directionality ==
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_3513]]
+
−
** [[pantograph]]-[[athaliana]]
+
−
* [[Tiso_gene_7322]]
+
−
** [[pantograph]]-[[athaliana]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[athaliana]]
+
−
*** [[esiliculosus]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=31302 31302]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245670 25245670]
−
* LIGAND-RXN:
+
* CHEBI:
−
** [http://www.genome.jp/dbget-bin/www_bget?R06366 R06366]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58011 58011]
−
{{#set: direction=REVERSIBLE}}
+
* LIGAND-CPD:
−
{{#set: common name=perillyl aldehyde dehydrogenase}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C03427 C03427]
−
{{#set: ec number=EC-1.2.1.3}}
+
* HMDB : HMDB03023
−
{{#set: gene associated=Tiso_gene_3513|Tiso_gene_7322}}
+
{{#set: smiles=CC(=CCCC(=CCCC(=CCCC(=CC1(C(CCC=C(CCC=C(CCC=C(C)C)C)C)(C1COP(OP(=O)([O-])[O-])([O-])=O)C))C)C)C)C}}
−
{{#set: in pathway=}}
+
{{#set: inchi key=InChIKey=RVCNKTPCHZNAAO-IMSLGMFESA-K}}
−
{{#set: reconstruction category=orthology}}
+
{{#set: common name=prephytoene diphosphate}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: molecular weight=719.897    }}
−
{{#set: reconstruction source=athaliana|esiliculosus}}
+
{{#set: common name=(1R,2R,3R)-prephytoene diphosphate}}
 +
{{#set: consumed by=RXNARA-8002|RXN-12245}}
 +
{{#set: produced by=2.5.1.32-RXN}}

Revision as of 17:36, 10 January 2018

Metabolite CPD-464

  • smiles:
    • CC(=CCCC(=CCCC(=CCCC(=CC1(C(CCC=C(CCC=C(CCC=C(C)C)C)C)(C1COP(OP(=O)([O-])[O-])([O-])=O)C))C)C)C)C
  • inchi key:
    • InChIKey=RVCNKTPCHZNAAO-IMSLGMFESA-K
  • common name:
    • prephytoene diphosphate
  • molecular weight:
    • 719.897
  • Synonym(s):
    • (1R,2R,3R)-prephytoene diphosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(=CCCC(=CCCC(=CCCC(=CC1(C(CCC=C(CCC=C(CCC=C(C)C)C)C)(C1COP(OP(=O)([O-])[O-])([O-])=O)C))C)C)C)C" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RIBITOL-2-DEHYDROGENASE-RXN&oldid=18618"