Difference between revisions of "RXN-5962"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_8653 == * left end position: ** 2429 * transcription direction: ** POSITIVE * right end position: ** 5209 * centisome position: ** 24.27058...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-139 CPD1F-139] == * smiles: ** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC(O)2)([CH](CC3)4)...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-139 CPD1F-139] == |
− | * | + | * smiles: |
− | ** | + | ** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC(O)2)([CH](CC3)4)5)(C)))C([O-])=O))) |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=JLJLRLWOEMWYQK-SNTJWBGVSA-M |
− | * | + | * common name: |
− | ** | + | ** gibberellin A1 |
− | * | + | * molecular weight: |
− | ** | + | ** 347.387 |
* Synonym(s): | * Synonym(s): | ||
+ | ** GA1 | ||
+ | ** gibberellin 1 | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-115]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202506 25202506] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27717 27717] |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00859 C00859] |
+ | {{#set: smiles=C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC(O)2)([CH](CC3)4)5)(C)))C([O-])=O)))}} | ||
+ | {{#set: inchi key=InChIKey=JLJLRLWOEMWYQK-SNTJWBGVSA-M}} | ||
+ | {{#set: common name=gibberellin A1}} | ||
+ | {{#set: molecular weight=347.387 }} | ||
+ | {{#set: common name=GA1|gibberellin 1}} | ||
+ | {{#set: consumed by=RXN-115}} |
Revision as of 18:37, 10 January 2018
Contents
Metabolite CPD1F-139
- smiles:
- C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC(O)2)([CH](CC3)4)5)(C)))C([O-])=O)))
- inchi key:
- InChIKey=JLJLRLWOEMWYQK-SNTJWBGVSA-M
- common name:
- gibberellin A1
- molecular weight:
- 347.387
- Synonym(s):
- GA1
- gibberellin 1
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC(O)2)([CH](CC3)4)5)(C)))C([O-])=O)))" cannot be used as a page name in this wiki.