Difference between revisions of "HYPOXANPRIBOSYLTRAN-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-702 CPD-702] == * smiles: ** C(O)C1(C=CC(=CC=1)[N+]([O-])=O) * inchi key: ** InChIKey=JKTYG...") |
(Created page with "Category:Gene == Gene Tiso_gene_3315 == * left end position: ** 14801 * transcription direction: ** POSITIVE * right end position: ** 16519 * centisome position: ** 86.911...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_3315 == |
| − | * | + | * left end position: |
| − | ** | + | ** 14801 |
| − | * | + | * transcription direction: |
| − | ** | + | ** POSITIVE |
| − | * | + | * right end position: |
| − | ** | + | ** 16519 |
| − | * | + | * centisome position: |
| − | ** | + | ** 86.91133 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == | + | == Reactions associated == |
| − | + | * [[3.5.1.98-RXN]] | |
| − | * [[ | + | ** in-silico_annotation |
| − | == | + | ***automated-name-match |
| + | == Pathways associated == | ||
== External links == | == External links == | ||
| − | + | {{#set: left end position=14801}} | |
| − | + | {{#set: transcription direction=POSITIVE}} | |
| − | + | {{#set: right end position=16519}} | |
| − | + | {{#set: centisome position=86.91133 }} | |
| − | + | {{#set: reaction associated=3.5.1.98-RXN}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
Revision as of 17:38, 10 January 2018
Gene Tiso_gene_3315
- left end position:
- 14801
- transcription direction:
- POSITIVE
- right end position:
- 16519
- centisome position:
- 86.91133
- Synonym(s):
Reactions associated
- 3.5.1.98-RXN
- in-silico_annotation
- automated-name-match
- in-silico_annotation
