Difference between revisions of "CPD-702"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_12792 == * left end position: ** 3927 * transcription direction: ** POSITIVE * right end position: ** 6529 * centisome position: ** 58.4810...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2461 CPD0-2461] == * smiles: ** C2(=NC1(=C(NC(N=C(N)1)=O)N2)) * inchi key: ** InChIKey=DRA...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2461 CPD0-2461] == |
| − | * | + | * smiles: |
| − | ** | + | ** C2(=NC1(=C(NC(N=C(N)1)=O)N2)) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=DRAVOWXCEBXPTN-UHFFFAOYSA-N |
| − | * | + | * common name: |
| − | ** | + | ** isoguanine |
| − | * | + | * molecular weight: |
| − | ** | + | ** 151.127 |
* Synonym(s): | * Synonym(s): | ||
| + | ** 2-oxoadenine | ||
| + | ** 2-hydroxyadenine | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-15139]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=76900 76900] |
| − | {{#set: | + | * CHEMSPIDER: |
| − | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.69351.html 69351] |
| − | {{#set: | + | * CHEBI: |
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62462 62462] | ||
| + | * HMDB : HMDB00403 | ||
| + | {{#set: smiles=C2(=NC1(=C(NC(N=C(N)1)=O)N2))}} | ||
| + | {{#set: inchi key=InChIKey=DRAVOWXCEBXPTN-UHFFFAOYSA-N}} | ||
| + | {{#set: common name=isoguanine}} | ||
| + | {{#set: molecular weight=151.127 }} | ||
| + | {{#set: common name=2-oxoadenine|2-hydroxyadenine}} | ||
| + | {{#set: produced by=RXN-15139}} | ||
Revision as of 17:38, 10 January 2018
Contents
Metabolite CPD0-2461
- smiles:
- C2(=NC1(=C(NC(N=C(N)1)=O)N2))
- inchi key:
- InChIKey=DRAVOWXCEBXPTN-UHFFFAOYSA-N
- common name:
- isoguanine
- molecular weight:
- 151.127
- Synonym(s):
- 2-oxoadenine
- 2-hydroxyadenine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
