Difference between revisions of "RXN1G-364"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_15790 == * left end position: ** 343 * transcription direction: ** POSITIVE * right end position: ** 3937 * centisome position: ** 7.160751...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXY-ISOVALERYL-COA 3-HYDROXY-ISOVALERYL-COA] == * smiles: ** CC(COP(=O)([O-])OP(=O)([O-])...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXY-ISOVALERYL-COA 3-HYDROXY-ISOVALERYL-COA] == |
− | * | + | * smiles: |
− | ** | + | ** CC(COP(=O)([O-])OP(=O)([O-])OCC3(C(C(C(N2(C=NC1(C(=NC=NC=12)N)))O3)O)OP([O-])([O-])=O))(C)C(C(NCCC(NCCSC(=O)CC(C)(C)O)=O)=O)O |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=PEVZKILCBDEOBT-UHFFFAOYSA-J |
− | * | + | * common name: |
− | ** | + | ** 3-hydroxyisovaleryl-CoA |
− | * | + | * molecular weight: |
− | ** | + | ** 863.619 |
* Synonym(s): | * Synonym(s): | ||
+ | ** 3-hydroxy-isovaleryl-coa | ||
+ | ** 3-hydroxy-iso-valeryl-CoA | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[RXN-14266]] | |
− | == | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203667 25203667] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62555 62555] |
− | {{#set: | + | {{#set: smiles=CC(COP(=O)([O-])OP(=O)([O-])OCC3(C(C(C(N2(C=NC1(C(=NC=NC=12)N)))O3)O)OP([O-])([O-])=O))(C)C(C(NCCC(NCCSC(=O)CC(C)(C)O)=O)=O)O}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=PEVZKILCBDEOBT-UHFFFAOYSA-J}} |
+ | {{#set: common name=3-hydroxyisovaleryl-CoA}} | ||
+ | {{#set: molecular weight=863.619 }} | ||
+ | {{#set: common name=3-hydroxy-isovaleryl-coa|3-hydroxy-iso-valeryl-CoA}} | ||
+ | {{#set: consumed or produced by=RXN-14266}} |
Revision as of 18:38, 10 January 2018
Contents
Metabolite 3-HYDROXY-ISOVALERYL-COA
- smiles:
- CC(COP(=O)([O-])OP(=O)([O-])OCC3(C(C(C(N2(C=NC1(C(=NC=NC=12)N)))O3)O)OP([O-])([O-])=O))(C)C(C(NCCC(NCCSC(=O)CC(C)(C)O)=O)=O)O
- inchi key:
- InChIKey=PEVZKILCBDEOBT-UHFFFAOYSA-J
- common name:
- 3-hydroxyisovaleryl-CoA
- molecular weight:
- 863.619
- Synonym(s):
- 3-hydroxy-isovaleryl-coa
- 3-hydroxy-iso-valeryl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(COP(=O)([O-])OP(=O)([O-])OCC3(C(C(C(N2(C=NC1(C(=NC=NC=12)N)))O3)O)OP([O-])([O-])=O))(C)C(C(NCCC(NCCSC(=O)CC(C)(C)O)=O)=O)O" cannot be used as a page name in this wiki.