Difference between revisions of "RXN-13322"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1242 CPD-1242] == * smiles: ** C(O)C1(OC(C(C(C1O)=O)O)O) * inchi key: ** InChIKey=APIQNBNBI...") |
(Created page with "Category:Gene == Gene Tiso_gene_18321 == * left end position: ** 215 * transcription direction: ** NEGATIVE * right end position: ** 3002 * centisome position: ** 6.942202...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_18321 == |
− | * | + | * left end position: |
− | ** | + | ** 215 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 3002 |
− | * | + | * centisome position: |
− | ** | + | ** 6.942202 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | + | * [[PEPTIDYLPROLYL-ISOMERASE-RXN]] | |
− | * [[ | + | ** in-silico_annotation |
− | == | + | ***ec-number |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=215}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=3002}} | |
− | + | {{#set: centisome position=6.942202 }} | |
− | + | {{#set: reaction associated=PEPTIDYLPROLYL-ISOMERASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 18:52, 18 March 2018
Gene Tiso_gene_18321
- left end position:
- 215
- transcription direction:
- NEGATIVE
- right end position:
- 3002
- centisome position:
- 6.942202
- Synonym(s):
Reactions associated
- PEPTIDYLPROLYL-ISOMERASE-RXN
- in-silico_annotation
- ec-number
- in-silico_annotation