Difference between revisions of "RXN-14037"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PANTETHEINE-P PANTETHEINE-P] == * smiles: ** CC(C(O)C(=O)NCCC(NCCS)=O)(C)COP([O-])(=O)[O-] * in...") |
(Created page with "Category:Gene == Gene Tiso_gene_16125 == * left end position: ** 24 * transcription direction: ** POSITIVE * right end position: ** 4447 * centisome position: ** 0.5251640...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_16125 == |
| − | * | + | * left end position: |
| − | ** | + | ** 24 |
| − | * | + | * transcription direction: |
| − | ** | + | ** POSITIVE |
| − | * | + | * right end position: |
| − | ** | + | ** 4447 |
| − | * | + | * centisome position: |
| − | ** | + | ** 0.52516407 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | == | + | == Reactions associated == |
| − | * [[ | + | * [[3.2.1.58-RXN]] |
| − | + | ** experimental_annotation | |
| − | * [[ | + | ***ec-number |
| − | == | + | ** [[pantograph]]-[[esiliculosus]] |
| − | + | == Pathways associated == | |
== External links == | == External links == | ||
| − | + | {{#set: left end position=24}} | |
| − | + | {{#set: transcription direction=POSITIVE}} | |
| − | + | {{#set: right end position=4447}} | |
| − | + | {{#set: centisome position=0.52516407 }} | |
| − | + | {{#set: reaction associated=3.2.1.58-RXN}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | + | ||
Revision as of 17:52, 18 March 2018
Gene Tiso_gene_16125
- left end position:
- 24
- transcription direction:
- POSITIVE
- right end position:
- 4447
- centisome position:
- 0.52516407
- Synonym(s):
Reactions associated
- 3.2.1.58-RXN
- experimental_annotation
- ec-number
- pantograph-esiliculosus
- experimental_annotation
