Difference between revisions of "PWY-3722"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14916 CPD-14916] == * smiles: ** CCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-4081 PWY-4081] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] **...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14916 CPD-14916] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-4081 PWY-4081] ==
* smiles:
+
* taxonomic range:
** CCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
** InChIKey=ATVGTMKWKDUCMS-JWBYWSJJSA-J
+
 
* common name:
 
* common name:
** (R)-3-hydroxyoctanoyl-CoA
+
** glutathione-peroxide redox reactions
* molecular weight:
+
** 905.7   
+
 
* Synonym(s):
 
* Synonym(s):
** (R)-3-hydroxyoctanoyl-CoA
 
** (3R)-3-hydroxyoctanoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-14275]]
+
'''3''' reactions found over '''3''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[1.11.1.12-RXN]]
* [[RXN-14276]]
+
** 0 associated gene:
== Reaction(s) of unknown directionality ==
+
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[annotation-experimental_annotation]]
 +
* [[GLUTATHIONE-PEROXIDASE-RXN]]
 +
** 4 associated gene(s):
 +
*** [[Tiso_gene_6679]]
 +
*** [[Tiso_gene_8644]]
 +
*** [[Tiso_gene_1377]]
 +
*** [[Tiso_gene_6680]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-synechocystis]]
 +
*** [[orthology-esiliculosus]]
 +
* [[GLUTATHIONE-REDUCT-NADPH-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_12533]]
 +
*** [[Tiso_gene_2804]]
 +
** 5 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[annotation-experimental_annotation]]
 +
*** [[manual-primary_network]]
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173319 46173319]
+
{{#set: taxonomic range=TAX-2759}}
* CHEBI:
+
{{#set: common name=glutathione-peroxide redox reactions}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74279 74279]
+
{{#set: reaction found=3}}
* BIGG : 3hocoa
+
{{#set: total reaction=3}}
{{#set: smiles=CCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O}}
+
{{#set: completion rate=100.0}}
{{#set: inchi key=InChIKey=ATVGTMKWKDUCMS-JWBYWSJJSA-J}}
+
{{#set: common name=(R)-3-hydroxyoctanoyl-CoA}}
+
{{#set: molecular weight=905.7    }}
+
{{#set: common name=(R)-3-hydroxyoctanoyl-CoA|(3R)-3-hydroxyoctanoyl-CoA}}
+
{{#set: consumed by=RXN-14275}}
+
{{#set: produced by=RXN-14276}}
+

Revision as of 17:54, 18 March 2018

Pathway PWY-4081

  • taxonomic range:
  • common name:
    • glutathione-peroxide redox reactions
  • Synonym(s):

Reaction(s) found

3 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links