Difference between revisions of "TRPCAT-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-786 CPD-786] == * smiles: ** C(CCC=CC(C([O-])=O)=O)([O-])=O * inchi key: ** InChIKey=HYVSZV...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.7.1.148-RXN 2.7.1.148-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** 4-diphosphocytidyl-...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.7.1.148-RXN 2.7.1.148-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** 4-diphosphocytidyl-2-c-methyl-d-erythritol_kinase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.7.1.148 EC-2.7.1.148] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | * [[ | + | ** 1 [[ATP]][c] '''+''' 1 [[4-CYTIDINE-5-DIPHOSPHO-2-C]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET]][c] '''+''' 1 [[ADP]][c] |
− | == | + | * With common name(s): |
+ | ** 1 ATP[c] '''+''' 1 4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol[c] '''=>''' 1 H+[c] '''+''' 1 2-phospho-4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol[c] '''+''' 1 ADP[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * [[Tiso_gene_13463]] | ||
+ | ** IN-SILICO_ANNOTATION | ||
+ | ***EC-NUMBER | ||
+ | ** EXPERIMENTAL_ANNOTATION | ||
+ | ***EC-NUMBER | ||
+ | ** [[pantograph]]-[[athaliana]] | ||
+ | ** [[pantograph]]-[[synechocystis]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | ** [[pantograph]]-[[creinhardtii]] | ||
+ | == Pathways == | ||
+ | * [[NONMEVIPP-PWY]], methylerythritol phosphate pathway I: [http://metacyc.org/META/NEW-IMAGE?object=NONMEVIPP-PWY NONMEVIPP-PWY] | ||
+ | ** '''9''' reactions found over '''9''' reactions in the full pathway | ||
+ | * [[PWY-7560]], methylerythritol phosphate pathway II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7560 PWY-7560] | ||
+ | ** '''9''' reactions found over '''9''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-synechocystis]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[manual]] | ||
+ | ** Source: [[manual-primary_network]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=18437 18437] | |
− | + | * LIGAND-RXN: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R05634 R05634] | |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | ** [http://www.ebi.ac.uk/ | + | {{#set: common name=4-diphosphocytidyl-2-c-methyl-d-erythritol_kinase}} |
− | * LIGAND- | + | {{#set: ec number=EC-2.7.1.148}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: gene associated=Tiso_gene_13463}} |
− | {{#set: | + | {{#set: in pathway=NONMEVIPP-PWY|PWY-7560}} |
− | {{#set: | + | {{#set: reconstruction category=orthology|manual|annotation}} |
− | {{#set: | + | {{#set: reconstruction source=annotation-experimental_annotation|orthology-esiliculosus|annotation-in-silico_annotation|orthology-athaliana|orthology-synechocystis|manual-primary_network|orthology-creinhardtii}} |
− | {{#set: | + | {{#set: reconstruction tool=pantograph|pathwaytools}} |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 17:54, 18 March 2018
Contents
Reaction 2.7.1.148-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- 4-diphosphocytidyl-2-c-methyl-d-erythritol_kinase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 ATP[c] + 1 4-CYTIDINE-5-DIPHOSPHO-2-C[c] => 1 PROTON[c] + 1 2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET[c] + 1 ADP[c]
- With common name(s):
- 1 ATP[c] + 1 4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol[c] => 1 H+[c] + 1 2-phospho-4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol[c] + 1 ADP[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Tiso_gene_13463
- IN-SILICO_ANNOTATION
- EC-NUMBER
- EXPERIMENTAL_ANNOTATION
- EC-NUMBER
- pantograph-athaliana
- pantograph-synechocystis
- pantograph-esiliculosus
- pantograph-creinhardtii
- IN-SILICO_ANNOTATION
Pathways
- NONMEVIPP-PWY, methylerythritol phosphate pathway I: NONMEVIPP-PWY
- 9 reactions found over 9 reactions in the full pathway
- PWY-7560, methylerythritol phosphate pathway II: PWY-7560
- 9 reactions found over 9 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-athaliana
- Tool: pantograph
- Source: orthology-creinhardtii
- Tool: pantograph
- Source: orthology-synechocystis
- Tool: pantograph
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-athaliana
- Category: manual
- Source: manual-primary_network
- Category: annotation
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation
External links