Difference between revisions of "GLUCOSE-6-PHOSPHATE-1-EPIMERASE-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_17244 == * left end position: ** 2440 * transcription direction: ** POSITIVE * right end position: ** 3425 * centisome position: ** 63.6909...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1301 CPD-1301] == * smiles: ** C([CH]2(NC1(C(NC(=NC=1NC2)N)=O)))NC3(=CC=C(C(NC(C(=O)[O-])CC...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_17244 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1301 CPD-1301] ==
−
* left end position:
+
* smiles:
−
** 2440
+
** C([CH]2(NC1(C(NC(=NC=1NC2)N)=O)))NC3(=CC=C(C(NC(C(=O)[O-])CCC(NC(C(=O)[O-])CCC(NC(C(=O)[O-])CCC([O-])=O)=O)=O)=O)C=C3)
−
* transcription direction:
+
* inchi key:
−
** POSITIVE
+
** InChIKey=RXWVHRYZTWZATH-XSLAGTTESA-J
−
* right end position:
+
* common name:
−
** 3425
+
** tetrahydropteroyl tri-L-glutamate
−
* centisome position:
+
* molecular weight:
−
** 63.69094    
+
** 699.633    
 
* Synonym(s):
 
* Synonym(s):
 +
** H4PteGlu3
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[RXN-11598]]
+
== Reaction(s) known to produce the compound ==
−
** in-silico_annotation
+
== Reaction(s) of unknown directionality ==
−
***automated-name-match
+
* [[HOMOCYSMET-RXN]]
−
** experimental_annotation
+
−
***automated-name-match
+
−
* [[RXN-14177]]
+
−
** [[pantograph]]-[[athaliana]]
+
−
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=2440}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49791999 49791999]
−
{{#set: right end position=3425}}
+
* CHEMSPIDER:
−
{{#set: centisome position=63.69094   }}
+
** [http://www.chemspider.com/Chemical-Structure.17625690.html 17625690]
−
{{#set: reaction associated=RXN-11598|RXN-14177}}
+
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58140 58140]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C04144 C04144]
 +
* HMDB : HMDB12290
 +
{{#set: smiles=C([CH]2(NC1(C(NC(=NC=1NC2)N)=O)))NC3(=CC=C(C(NC(C(=O)[O-])CCC(NC(C(=O)[O-])CCC(NC(C(=O)[O-])CCC([O-])=O)=O)=O)=O)C=C3)}}
 +
{{#set: inchi key=InChIKey=RXWVHRYZTWZATH-XSLAGTTESA-J}}
 +
{{#set: common name=tetrahydropteroyl tri-L-glutamate}}
 +
{{#set: molecular weight=699.633   }}
 +
{{#set: common name=H4PteGlu3}}
 +
{{#set: reversible reaction associated=HOMOCYSMET-RXN}}

Revision as of 17:54, 18 March 2018

Metabolite CPD-1301

  • smiles:
    • C([CH]2(NC1(C(NC(=NC=1NC2)N)=O)))NC3(=CC=C(C(NC(C(=O)[O-])CCC(NC(C(=O)[O-])CCC(NC(C(=O)[O-])CCC([O-])=O)=O)=O)=O)C=C3)
  • inchi key:
    • InChIKey=RXWVHRYZTWZATH-XSLAGTTESA-J
  • common name:
    • tetrahydropteroyl tri-L-glutamate
  • molecular weight:
    • 699.633
  • Synonym(s):
    • H4PteGlu3

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C([CH]2(NC1(C(NC(=NC=1NC2)N)=O)))NC3(=CC=C(C(NC(C(=O)[O-])CCC(NC(C(=O)[O-])CCC(NC(C(=O)[O-])CCC([O-])=O)=O)=O)=O)C=C3)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=GLUCOSE-6-PHOSPHATE-1-EPIMERASE-RXN&oldid=20557"