Difference between revisions of "Tiso gene 11351"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15699 CPD-15699] == * smiles: ** [CH](=O)C(O)C(O)C(O)CO * inchi key: ** InChIKey=PYMYPHUHKU...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-4381 PWY-4381] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15699 CPD-15699] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-4381 PWY-4381] ==
−
* smiles:
+
* taxonomic range:
−
** [CH](=O)C(O)C(O)C(O)CO
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
−
** InChIKey=PYMYPHUHKUWMLA-VAYJURFESA-N
+
 
* common name:
 
* common name:
−
** aldehydo-L-arabinose
+
** fatty acid biosynthesis initiation I
−
* molecular weight:
+
−
** 150.131   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** de novo fatty acid biosynthesis, initial reactions
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''3''' reactions found over '''3''' reactions in the full pathway
−
== Reaction(s) of unknown directionality ==
+
* [[2.3.1.180-RXN]]
−
* [[RXN-14102]]
+
** 1 associated gene(s):
−
* [[RXN-14808]]
+
*** [[Tiso_gene_15991]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[annotation-experimental_annotation]]
 +
* [[ACETYL-COA-CARBOXYLTRANSFER-RXN]]
 +
** 4 associated gene(s):
 +
*** [[Tiso_gene_7965]]
 +
*** [[Tiso_gene_2812]]
 +
*** [[Tiso_gene_5029]]
 +
*** [[Tiso_gene_3800]]
 +
** 5 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[manual-primary_network]]
 +
*** [[orthology-esiliculosus]]
 +
* [[MALONYL-COA-ACP-TRANSACYL-RXN]]
 +
** 7 associated gene(s):
 +
*** [[Tiso_gene_500]]
 +
*** [[Tiso_gene_10876]]
 +
*** [[Tiso_gene_136]]
 +
*** [[Tiso_gene_19309]]
 +
*** [[Tiso_gene_135]]
 +
*** [[Tiso_gene_18460]]
 +
*** [[Tiso_gene_13394]]
 +
** 5 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[manual-primary_network]]
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-synechocystis]]
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* ECOCYC:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460291 5460291]
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-4381 PWY-4381]
−
* CHEBI:
+
* ARACYC:
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=6182 6182]
+
** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-4381 PWY-4381]
−
* LIGAND-CPD:
+
{{#set: taxonomic range=TAX-2759}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C11476 C11476]
+
{{#set: taxonomic range=TAX-2}}
−
{{#set: smiles=[CH](=O)C(O)C(O)C(O)CO}}
+
{{#set: common name=fatty acid biosynthesis initiation I}}
−
{{#set: inchi key=InChIKey=PYMYPHUHKUWMLA-VAYJURFESA-N}}
+
{{#set: common name=de novo fatty acid biosynthesis, initial reactions}}
−
{{#set: common name=aldehydo-L-arabinose}}
+
{{#set: reaction found=3}}
−
{{#set: molecular weight=150.131    }}
+
{{#set: total reaction=3}}
−
{{#set: consumed or produced by=RXN-14102|RXN-14808}}
+
{{#set: completion rate=100.0}}

Revision as of 17:55, 18 March 2018

Pathway PWY-4381

  • taxonomic range:
  • common name:
    • fatty acid biosynthesis initiation I
  • Synonym(s):
    • de novo fatty acid biosynthesis, initial reactions

Reaction(s) found

3 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_11351&oldid=20626"