Difference between revisions of "Tiso gene 12472"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYANURIC-ACID CYANURIC-ACID] == * smiles: ** C1(O)(=NC(O)=NC(O)=N1) * inchi key: ** InChIKey=ZF...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=VibB VibB] == * common name: ** an apo-[VibB aryl-carrier protein] * Synonym(s): == Reaction(s...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYANURIC-ACID CYANURIC-ACID] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=VibB VibB] ==
* smiles:
+
** C1(O)(=NC(O)=NC(O)=N1)
+
* inchi key:
+
** InChIKey=ZFSLODLOARCGLH-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
** cyanurate
+
** an apo-[VibB aryl-carrier protein]
* molecular weight:
+
** 129.075   
+
 
* Synonym(s):
 
* Synonym(s):
** cyanuric acid
 
** 2,4,6-trihydroxy-s-triazine
 
** sym-triazine-2,4,6-triol
 
** 1,3,5-triazine-2,4,6-triol
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[R468-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[RXN-10994]]
 
== External links  ==
 
== External links  ==
* NCI:
+
{{#set: common name=an apo-[VibB aryl-carrier protein]}}
** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=6284 6284]
+
{{#set: reversible reaction associated=RXN-10994}}
* CAS : 108-80-5
+
* PUBCHEM:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7956 7956]
+
* HMDB : HMDB41861
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C06554 C06554]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.7668.html 7668]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=38028 38028]
+
{{#set: smiles=C1(O)(=NC(O)=NC(O)=N1)}}
+
{{#set: inchi key=InChIKey=ZFSLODLOARCGLH-UHFFFAOYSA-N}}
+
{{#set: common name=cyanurate}}
+
{{#set: molecular weight=129.075    }}
+
{{#set: common name=cyanuric acid|2,4,6-trihydroxy-s-triazine|sym-triazine-2,4,6-triol|1,3,5-triazine-2,4,6-triol}}
+
{{#set: consumed by=R468-RXN}}
+

Revision as of 17:55, 18 March 2018

Metabolite VibB

  • common name:
    • an apo-[VibB aryl-carrier protein]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"an apo-[VibB aryl-carrier protein" cannot be used as a page name in this wiki.