Difference between revisions of "RNA-Ligase-L-lysine-adenylate"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-3-DIHYDROXYBENZOATE 2-3-DIHYDROXYBENZOATE] == * smiles: ** C(C1(=CC=CC(=C1O)O))([O-])=O * inc...") |
(Created page with "Category:Gene == Gene Tiso_gene_13083 == * left end position: ** 2216 * transcription direction: ** POSITIVE * right end position: ** 3632 * centisome position: ** 33.8682...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_13083 == |
− | * | + | * left end position: |
− | ** | + | ** 2216 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 3632 |
− | * | + | * centisome position: |
− | ** | + | ** 33.868256 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * [[2.3.1.41-RXN]] | |
− | * [[ | + | ** experimental_annotation |
− | == | + | ***automated-name-match |
+ | * [[3-OXOACYL-ACP-REDUCT-RXN]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | ** experimental_annotation | ||
+ | ***ec-number | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[PYRIDOXAL-4-DEHYDROGENASE-RXN]] | ||
+ | ** experimental_annotation | ||
+ | ***automated-name-match | ||
+ | * [[RXN-10060]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | ** experimental_annotation | ||
+ | ***ec-number | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN-10655]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | ** experimental_annotation | ||
+ | ***ec-number | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN-10659]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | ** experimental_annotation | ||
+ | ***ec-number | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN-11476]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | ** experimental_annotation | ||
+ | ***ec-number | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN-11480]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | ** experimental_annotation | ||
+ | ***ec-number | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN-12994]] | ||
+ | ** experimental_annotation | ||
+ | ***automated-name-match | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN-13008]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | ** experimental_annotation | ||
+ | ***ec-number | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN-13443]] | ||
+ | ** experimental_annotation | ||
+ | ***automated-name-match | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN-16616]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | ** experimental_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN-16622]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | ** experimental_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN-16626]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | ** experimental_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN-16630]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | ** experimental_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN-9514]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | ** experimental_annotation | ||
+ | ***ec-number | ||
+ | ** [[pantograph]]-[[synechocystis]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN-9518]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | ** experimental_annotation | ||
+ | ***ec-number | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN-9524]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | ** experimental_annotation | ||
+ | ***ec-number | ||
+ | ** [[pantograph]]-[[synechocystis]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN-9528]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | ** experimental_annotation | ||
+ | ***ec-number | ||
+ | ** [[pantograph]]-[[synechocystis]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN-9532]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | ** experimental_annotation | ||
+ | ***ec-number | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN-9536]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | ** experimental_annotation | ||
+ | ***ec-number | ||
+ | ** [[pantograph]]-[[synechocystis]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN-9540]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | ** experimental_annotation | ||
+ | ***ec-number | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN-9544]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN-9552]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | ** experimental_annotation | ||
+ | ***ec-number | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN-9556]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | ** experimental_annotation | ||
+ | ***ec-number | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN-9633]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | ** experimental_annotation | ||
+ | ***ec-number | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN0-2142]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | ** experimental_annotation | ||
+ | ***ec-number | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN1G-1050]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN1G-1053]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN1G-1247]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN1G-157]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | ** experimental_annotation | ||
+ | ***ec-number | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN1G-163]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN1G-182]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN1G-184]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN1G-203]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN1G-240]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN1G-252]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN1G-260]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN1G-262]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN1G-287]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN1G-349]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | ** experimental_annotation | ||
+ | ***ec-number | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN1G-358]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN1G-364]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN1G-384]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN1G-408]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN1G-409]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN1G-469]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | ** experimental_annotation | ||
+ | ***ec-number | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN1G-481]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN1G-508]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | ** experimental_annotation | ||
+ | ***ec-number | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN1G-613]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN1G-617]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN1G-637]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN1G-717]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN1G-72]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN1G-853]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN1G-881]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN1G-951]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7388]] | ||
+ | * [[PWY-5367]] | ||
+ | * [[PWY-5972]] | ||
+ | * [[PWY-5973]] | ||
+ | * [[PWY-5971]] | ||
+ | * [[PWY-5499]] | ||
+ | * [[PWY0-862]] | ||
+ | * [[PWY-7053]] | ||
+ | * [[PWY-6113]] | ||
+ | * [[PWY-7619]] | ||
+ | * [[PWY-6282]] | ||
+ | * [[PWY-5994]] | ||
+ | * [[PWY3O-355]] | ||
+ | * [[PWY-7724]] | ||
+ | * [[PWY-7727]] | ||
+ | * [[FASYN-ELONG-PWY]] | ||
+ | * [[PWY-6519]] | ||
+ | * [[PWY-7602]] | ||
+ | * [[PWY-7606]] | ||
+ | * [[PWY-5989]] | ||
+ | * [[PWYG-321]] | ||
+ | * [[PWY-7663]] | ||
+ | * [[PWY-7664]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=2216}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=3632}} | |
− | + | {{#set: centisome position=33.868256 }} | |
− | + | {{#set: reaction associated=2.3.1.41-RXN|3-OXOACYL-ACP-REDUCT-RXN|PYRIDOXAL-4-DEHYDROGENASE-RXN|RXN-10060|RXN-10655|RXN-10659|RXN-11476|RXN-11480|RXN-12994|RXN-13008|RXN-13443|RXN-16616|RXN-16622|RXN-16626|RXN-16630|RXN-9514|RXN-9518|RXN-9524|RXN-9528|RXN-9532|RXN-9536|RXN-9540|RXN-9544|RXN-9552|RXN-9556|RXN-9633|RXN0-2142|RXN1G-1050|RXN1G-1053|RXN1G-1247|RXN1G-157|RXN1G-163|RXN1G-182|RXN1G-184|RXN1G-203|RXN1G-240|RXN1G-252|RXN1G-260|RXN1G-262|RXN1G-287|RXN1G-349|RXN1G-358|RXN1G-364|RXN1G-384|RXN1G-408|RXN1G-409|RXN1G-469|RXN1G-481|RXN1G-508|RXN1G-613|RXN1G-617|RXN1G-637|RXN1G-717|RXN1G-72|RXN1G-853|RXN1G-881|RXN1G-951}} | |
− | + | {{#set: pathway associated=PWY-7388|PWY-5367|PWY-5972|PWY-5973|PWY-5971|PWY-5499|PWY0-862|PWY-7053|PWY-6113|PWY-7619|PWY-6282|PWY-5994|PWY3O-355|PWY-7724|PWY-7727|FASYN-ELONG-PWY|PWY-6519|PWY-7602|PWY-7606|PWY-5989|PWYG-321|PWY-7663|PWY-7664}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 17:55, 18 March 2018
Gene Tiso_gene_13083
- left end position:
- 2216
- transcription direction:
- POSITIVE
- right end position:
- 3632
- centisome position:
- 33.868256
- Synonym(s):
Reactions associated
- 2.3.1.41-RXN
- experimental_annotation
- automated-name-match
- experimental_annotation
- 3-OXOACYL-ACP-REDUCT-RXN
- in-silico_annotation
- ec-number
- experimental_annotation
- ec-number
- pantograph-esiliculosus
- in-silico_annotation
- PYRIDOXAL-4-DEHYDROGENASE-RXN
- experimental_annotation
- automated-name-match
- experimental_annotation
- RXN-10060
- in-silico_annotation
- ec-number
- experimental_annotation
- ec-number
- pantograph-esiliculosus
- in-silico_annotation
- RXN-10655
- in-silico_annotation
- ec-number
- experimental_annotation
- ec-number
- pantograph-esiliculosus
- in-silico_annotation
- RXN-10659
- in-silico_annotation
- ec-number
- experimental_annotation
- ec-number
- pantograph-esiliculosus
- in-silico_annotation
- RXN-11476
- in-silico_annotation
- ec-number
- experimental_annotation
- ec-number
- pantograph-esiliculosus
- in-silico_annotation
- RXN-11480
- in-silico_annotation
- ec-number
- experimental_annotation
- ec-number
- pantograph-esiliculosus
- in-silico_annotation
- RXN-12994
- experimental_annotation
- automated-name-match
- pantograph-esiliculosus
- experimental_annotation
- RXN-13008
- in-silico_annotation
- ec-number
- experimental_annotation
- ec-number
- pantograph-esiliculosus
- in-silico_annotation
- RXN-13443
- experimental_annotation
- automated-name-match
- pantograph-esiliculosus
- experimental_annotation
- RXN-16616
- in-silico_annotation
- ec-number
- experimental_annotation
- ec-number
- in-silico_annotation
- RXN-16622
- in-silico_annotation
- ec-number
- experimental_annotation
- ec-number
- in-silico_annotation
- RXN-16626
- in-silico_annotation
- ec-number
- experimental_annotation
- ec-number
- in-silico_annotation
- RXN-16630
- in-silico_annotation
- ec-number
- experimental_annotation
- ec-number
- in-silico_annotation
- RXN-9514
- in-silico_annotation
- ec-number
- experimental_annotation
- ec-number
- pantograph-synechocystis
- pantograph-esiliculosus
- in-silico_annotation
- RXN-9518
- in-silico_annotation
- ec-number
- experimental_annotation
- ec-number
- pantograph-esiliculosus
- in-silico_annotation
- RXN-9524
- in-silico_annotation
- ec-number
- experimental_annotation
- ec-number
- pantograph-synechocystis
- pantograph-esiliculosus
- in-silico_annotation
- RXN-9528
- in-silico_annotation
- ec-number
- experimental_annotation
- ec-number
- pantograph-synechocystis
- pantograph-esiliculosus
- in-silico_annotation
- RXN-9532
- in-silico_annotation
- ec-number
- experimental_annotation
- ec-number
- pantograph-esiliculosus
- in-silico_annotation
- RXN-9536
- in-silico_annotation
- ec-number
- experimental_annotation
- ec-number
- pantograph-synechocystis
- pantograph-esiliculosus
- in-silico_annotation
- RXN-9540
- in-silico_annotation
- ec-number
- experimental_annotation
- ec-number
- pantograph-esiliculosus
- in-silico_annotation
- RXN-9544
- RXN-9552
- in-silico_annotation
- ec-number
- experimental_annotation
- ec-number
- pantograph-esiliculosus
- in-silico_annotation
- RXN-9556
- in-silico_annotation
- ec-number
- experimental_annotation
- ec-number
- pantograph-esiliculosus
- in-silico_annotation
- RXN-9633
- in-silico_annotation
- ec-number
- experimental_annotation
- ec-number
- pantograph-esiliculosus
- in-silico_annotation
- RXN0-2142
- in-silico_annotation
- ec-number
- experimental_annotation
- ec-number
- pantograph-esiliculosus
- in-silico_annotation
- RXN1G-1050
- RXN1G-1053
- RXN1G-1247
- RXN1G-157
- in-silico_annotation
- ec-number
- experimental_annotation
- ec-number
- pantograph-esiliculosus
- in-silico_annotation
- RXN1G-163
- RXN1G-182
- RXN1G-184
- RXN1G-203
- RXN1G-240
- RXN1G-252
- RXN1G-260
- RXN1G-262
- RXN1G-287
- RXN1G-349
- in-silico_annotation
- ec-number
- experimental_annotation
- ec-number
- pantograph-esiliculosus
- in-silico_annotation
- RXN1G-358
- RXN1G-364
- RXN1G-384
- RXN1G-408
- RXN1G-409
- RXN1G-469
- in-silico_annotation
- ec-number
- experimental_annotation
- ec-number
- pantograph-esiliculosus
- in-silico_annotation
- RXN1G-481
- RXN1G-508
- in-silico_annotation
- ec-number
- experimental_annotation
- ec-number
- pantograph-esiliculosus
- in-silico_annotation
- RXN1G-613
- RXN1G-617
- RXN1G-637
- RXN1G-717
- RXN1G-72
- RXN1G-853
- RXN1G-881
- RXN1G-951
Pathways associated
- PWY-7388
- PWY-5367
- PWY-5972
- PWY-5973
- PWY-5971
- PWY-5499
- PWY0-862
- PWY-7053
- PWY-6113
- PWY-7619
- PWY-6282
- PWY-5994
- PWY3O-355
- PWY-7724
- PWY-7727
- FASYN-ELONG-PWY
- PWY-6519
- PWY-7602
- PWY-7606
- PWY-5989
- PWYG-321
- PWY-7663
- PWY-7664