Difference between revisions of "Tiso gene 10837"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1081 CPD-1081] == * smiles: ** CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CC...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1101 RXN-1101] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1....")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1081 CPD-1081] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1101 RXN-1101] ==
−
* smiles:
+
* direction:
−
** CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=PESKGJQREUXSRR-UXIWKSIVSA-N
+
** [http://enzyme.expasy.org/EC/1.2.1.44 EC-1.2.1.44]
−
* common name:
+
−
** 5α-cholestan-3-one
+
−
* molecular weight:
+
−
** 386.66   
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
== Reaction(s) of unknown directionality ==
+
** 1 [[PROTON]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[P-COUMAROYL-COA]][c] '''=>''' 1 [[COUMARALDEHYDE]][c] '''+''' 1 [[CO-A]][c] '''+''' 1 [[NADP]][c]
−
* [[CHOLESTENONE-5-ALPHA-REDUCTASE-RXN]]
+
* With common name(s):
 +
** 1 H+[c] '''+''' 1 NADPH[c] '''+''' 1 4-coumaroyl-CoA[c] '''=>''' 1 4-coumaraldehyde[c] '''+''' 1 coenzyme A[c] '''+''' 1 NADP+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_15272]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
* [[Tiso_gene_9504]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
* [[Tiso_gene_11016]]
 +
** [[pantograph]]-[[athaliana]]
 +
== Pathways  ==
 +
* [[PWY-361]], phenylpropanoid biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-361 PWY-361]
 +
** '''7''' reactions found over '''15''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-athaliana]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* CAS : 566-88-1
+
* LIGAND-RXN:
−
* PUBCHEM:
+
** [http://www.genome.jp/dbget-bin/www_bget?R01615 R01615]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=92128 92128]
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* HMDB : HMDB00871
+
{{#set: ec number=EC-1.2.1.44}}
−
* LIGAND-CPD:
+
{{#set: gene associated=Tiso_gene_15272|Tiso_gene_9504|Tiso_gene_11016}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C03238 C03238]
+
{{#set: in pathway=PWY-361}}
−
* CHEMSPIDER:
+
{{#set: reconstruction category=orthology}}
−
** [http://www.chemspider.com/Chemical-Structure.83174.html 83174]
+
{{#set: reconstruction source=orthology-athaliana|orthology-esiliculosus}}
−
* CHEBI:
+
{{#set: reconstruction tool=pantograph}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17762 17762]
+
−
{{#set: smiles=CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))}}
+
−
{{#set: inchi key=InChIKey=PESKGJQREUXSRR-UXIWKSIVSA-N}}
+
−
{{#set: common name=5α-cholestan-3-one}}
+
−
{{#set: molecular weight=386.66    }}
+
−
{{#set: consumed or produced by=CHOLESTENONE-5-ALPHA-REDUCTASE-RXN}}
+

Revision as of 17:55, 18 March 2018

Reaction RXN-1101

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-361, phenylpropanoid biosynthesis: PWY-361
    • 7 reactions found over 15 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_10837&oldid=20690"