Difference between revisions of "Tiso gene 4521"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19160 CPD-19160] == * smiles: ** CCCCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13588 RXN-13588] == * direction: ** LEFT-TO-RIGHT * common name: ** [Fructose-bisphosphate aldo...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19160 CPD-19160] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13588 RXN-13588] ==
−
* smiles:
+
* direction:
−
** CCCCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=OUROWZUTGFHRJE-SAIINBSPSA-J
+
 
* common name:
 
* common name:
−
** 3-oxo-(11Z)-octadecenoyl-CoA
+
** [Fructose-bisphosphate aldolase]-lysine N-methyltransferase
−
* molecular weight:
+
* ec number:
−
** 1041.936   
+
** [http://enzyme.expasy.org/EC/2.1.1.259 EC-2.1.1.259]
 
* Synonym(s):
 
* Synonym(s):
−
** 3-oxo-18:1-Δ11-CoA
 
−
** 3-oxo-11-cis-octadecenoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-17787]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[Fructose-BisPO4-Aldolase-Lysine]][c] '''+''' 3 [[S-ADENOSYLMETHIONINE]][c] '''=>''' 1 [[Fructose-BisPO4-Aldolase-Tri-Me-Lysine]][c] '''+''' 3 [[PROTON]][c] '''+''' 3 [[ADENOSYL-HOMO-CYS]][c]
−
* [[RXN-17786]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 [fructose-bisphosphate aldolase]-lysine[c] '''+''' 3 S-adenosyl-L-methionine[c] '''=>''' 1 a [fructose-bisphosphate aldolase]-N6, N6,N6-trimethyl-L-lysine[c] '''+''' 3 H+[c] '''+''' 3 S-adenosyl-L-homocysteine[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_12516]]
 +
** EXPERIMENTAL_ANNOTATION
 +
***AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=CCCCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: direction=LEFT-TO-RIGHT}}
−
{{#set: inchi key=InChIKey=OUROWZUTGFHRJE-SAIINBSPSA-J}}
+
{{#set: common name=[Fructose-bisphosphate aldolase]-lysine N-methyltransferase}}
−
{{#set: common name=3-oxo-(11Z)-octadecenoyl-CoA}}
+
{{#set: ec number=EC-2.1.1.259}}
−
{{#set: molecular weight=1041.936    }}
+
{{#set: gene associated=Tiso_gene_12516}}
−
{{#set: common name=3-oxo-18:1-Δ11-CoA|3-oxo-11-cis-octadecenoyl-CoA}}
+
{{#set: in pathway=}}
−
{{#set: consumed by=RXN-17787}}
+
{{#set: reconstruction category=annotation}}
−
{{#set: produced by=RXN-17786}}
+
{{#set: reconstruction source=annotation-experimental_annotation}}
 +
{{#set: reconstruction tool=pathwaytools}}

Revision as of 17:56, 18 March 2018

Reaction RXN-13588

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • [Fructose-bisphosphate aldolase]-lysine N-methyltransferase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

"Fructose-bisphosphate aldolase]-lysine N-methyltransferase" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_4521&oldid=20726"