Difference between revisions of "Tiso gene 6277"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11919 RXN-11919] == * direction: ** LEFT-TO-RIGHT * common name: ** (2E)-5-methylhexa-2,4-dieno...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19160 CPD-19160] == * smiles: ** CCCCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19160 CPD-19160] == |
− | * | + | * smiles: |
− | ** | + | ** CCCCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
+ | * inchi key: | ||
+ | ** InChIKey=OUROWZUTGFHRJE-SAIINBSPSA-J | ||
* common name: | * common name: | ||
− | ** ( | + | ** 3-oxo-(11Z)-octadecenoyl-CoA |
− | * | + | * molecular weight: |
− | ** | + | ** 1041.936 |
* Synonym(s): | * Synonym(s): | ||
+ | ** 3-oxo-18:1-Δ11-CoA | ||
+ | ** 3-oxo-11-cis-octadecenoyl-CoA | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-17787]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-17786]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: smiles=CCCCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | |
− | + | {{#set: inchi key=InChIKey=OUROWZUTGFHRJE-SAIINBSPSA-J}} | |
− | {{#set: | + | {{#set: common name=3-oxo-(11Z)-octadecenoyl-CoA}} |
− | {{#set: common name=( | + | {{#set: molecular weight=1041.936 }} |
− | {{#set: | + | {{#set: common name=3-oxo-18:1-Δ11-CoA|3-oxo-11-cis-octadecenoyl-CoA}} |
− | {{#set: | + | {{#set: consumed by=RXN-17787}} |
− | + | {{#set: produced by=RXN-17786}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 18:56, 18 March 2018
Contents
Metabolite CPD-19160
- smiles:
- CCCCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=OUROWZUTGFHRJE-SAIINBSPSA-J
- common name:
- 3-oxo-(11Z)-octadecenoyl-CoA
- molecular weight:
- 1041.936
- Synonym(s):
- 3-oxo-18:1-Δ11-CoA
- 3-oxo-11-cis-octadecenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.