Difference between revisions of "Tiso gene 11386"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14931 CPD-14931] == * common name: ** a 10-formyltetrahydrofolate-4a-carbinolamine * Synony...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11670 CPD-11670] == * smiles: ** C(O)(=O)C1(CSC(N1)CC2(=CNC3(C2=CC(O)=CC=3))) * inchi key:...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11670 CPD-11670] == |
+ | * smiles: | ||
+ | ** C(O)(=O)C1(CSC(N1)CC2(=CNC3(C2=CC(O)=CC=3))) | ||
+ | * inchi key: | ||
+ | ** InChIKey=DFSPELNJAJEWOM-UHFFFAOYSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** 5-hydroxyindole thiazolidine carboxylate |
+ | * molecular weight: | ||
+ | ** 278.325 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 5-hydroxyindole thiazolidine carboxylic acid | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[RXN-10779]] | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=195334 195334] |
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.169392.html 169392] | ||
+ | {{#set: smiles=C(O)(=O)C1(CSC(N1)CC2(=CNC3(C2=CC(O)=CC=3)))}} | ||
+ | {{#set: inchi key=InChIKey=DFSPELNJAJEWOM-UHFFFAOYSA-N}} | ||
+ | {{#set: common name=5-hydroxyindole thiazolidine carboxylate}} | ||
+ | {{#set: molecular weight=278.325 }} | ||
+ | {{#set: common name=5-hydroxyindole thiazolidine carboxylic acid}} | ||
+ | {{#set: reversible reaction associated=RXN-10779}} |
Revision as of 18:56, 18 March 2018
Contents
Metabolite CPD-11670
- smiles:
- C(O)(=O)C1(CSC(N1)CC2(=CNC3(C2=CC(O)=CC=3)))
- inchi key:
- InChIKey=DFSPELNJAJEWOM-UHFFFAOYSA-N
- common name:
- 5-hydroxyindole thiazolidine carboxylate
- molecular weight:
- 278.325
- Synonym(s):
- 5-hydroxyindole thiazolidine carboxylic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links