Difference between revisions of "RXN-7784"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-RIBAZOLE-5-P ALPHA-RIBAZOLE-5-P] == * smiles: ** CC2(C(C)=CC1(N(C=NC=1C=2)C3(C(O)C(O)C(CO...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=GLYCOCAT-PWY GLYCOCAT-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 T...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-RIBAZOLE-5-P ALPHA-RIBAZOLE-5-P] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=GLYCOCAT-PWY GLYCOCAT-PWY] ==
−
* smiles:
+
* taxonomic range:
−
** CC2(C(C)=CC1(N(C=NC=1C=2)C3(C(O)C(O)C(COP([O-])(=O)[O-])O3)))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
−
* inchi key:
+
−
** InChIKey=ZMRGXEJKZPRBPJ-SYQHCUMBSA-L
+
 
* common name:
 
* common name:
−
** α-ribazole 5'-phosphate
+
** glycogen degradation I
−
* molecular weight:
+
−
** 356.271   
+
 
* Synonym(s):
 
* Synonym(s):
−
** N1-(5'-phospho-α-D-ribosyl)-5,6-dimethylbenzimidazole
+
** glycogen catabolism I
−
** DMB-ribose-5'-P
+
−
** α-ribazole-5'-P
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RIBAZOLEPHOSPHAT-RXN]]
+
'''6''' reactions found over '''8''' reactions in the full pathway
−
* [[R04594]]
+
* [[GLUCOKIN-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** 2 associated gene(s):
−
== Reaction(s) of unknown directionality ==
+
*** [[Tiso_gene_3107]]
−
* [[RXN-16788]]
+
*** [[Tiso_gene_1303]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-synechocystis]]
 +
*** [[orthology-esiliculosus]]
 +
* [[GLYCOPHOSPHORYL-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_1011]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
* [[PHOSPHOGLUCMUT-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_13477]]
 +
*** [[Tiso_gene_4816]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[manual-primary_network]]
 +
*** [[annotation-experimental_annotation]]
 +
* [[RXN-9025]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_1011]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
* [[RXN0-5182]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_1011]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
* [[RXN0-5183]]
 +
** 4 associated gene(s):
 +
*** [[Tiso_gene_599]]
 +
*** [[Tiso_gene_600]]
 +
*** [[Tiso_gene_4953]]
 +
*** [[Tiso_gene_4952]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=AMYLOMALT-RXN AMYLOMALT-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5146 RXN0-5146]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
* ECOCYC:
−
** [http://www.genome.jp/dbget-bin/www_bget?C04778 C04778]
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=GLYCOCAT-PWY GLYCOCAT-PWY]
−
* CHEBI:
+
{{#set: taxonomic range=TAX-2}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57918 57918]
+
{{#set: common name=glycogen degradation I}}
−
* BIGG : 5prdmbz
+
{{#set: common name=glycogen catabolism I}}
−
* PUBCHEM:
+
{{#set: reaction found=6}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49791947 49791947]
+
{{#set: total reaction=8}}
−
* HMDB : HMDB03882
+
{{#set: completion rate=75.0}}
−
{{#set: smiles=CC2(C(C)=CC1(N(C=NC=1C=2)C3(C(O)C(O)C(COP([O-])(=O)[O-])O3)))}}
+
−
{{#set: inchi key=InChIKey=ZMRGXEJKZPRBPJ-SYQHCUMBSA-L}}
+
−
{{#set: common name=α-ribazole 5'-phosphate}}
+
−
{{#set: molecular weight=356.271    }}
+
−
{{#set: common name=N1-(5'-phospho-α-D-ribosyl)-5,6-dimethylbenzimidazole|DMB-ribose-5'-P|α-ribazole-5'-P}}
+
−
{{#set: consumed by=RIBAZOLEPHOSPHAT-RXN|R04594}}
+
−
{{#set: consumed or produced by=RXN-16788}}
+

Revision as of 17:56, 18 March 2018

Pathway GLYCOCAT-PWY

  • taxonomic range:
  • common name:
    • glycogen degradation I
  • Synonym(s):
    • glycogen catabolism I

Reaction(s) found

6 reactions found over 8 reactions in the full pathway

Reaction(s) not found

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-7784&oldid=20789"