Difference between revisions of "Unwound-DNA"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7953 CPD-7953] == * smiles: ** CC(=CC=CC(=CC=CC(=CC=CC(=CC=CC=C(C=CC=C(C=CC1(C(CCCC=1C)(C)C...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6643 PWY-6643] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2191 TAX-21...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7953 CPD-7953] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6643 PWY-6643] ==
* smiles:
+
* taxonomic range:
** CC(=CC=CC(=CC=CC(=CC=CC(=CC=CC=C(C=CC=C(C=CC1(C(CCCC=1C)(C)C))C)C)C)C)C)C
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2191 TAX-2191]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-94695 TAX-94695]
** InChIKey=AIBOHNYYKWYQMM-IQKLXLPLSA-N
+
 
* common name:
 
* common name:
** torulene
+
** coenzyme M biosynthesis II
* molecular weight:
+
** 534.867   
+
 
* Synonym(s):
 
* Synonym(s):
** 3',4'-didehydro-β,ψ-carotene
+
** CoM biosynthesis II
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-11989]]
+
'''1''' reactions found over '''6''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[RXN-11737]]
== Reaction(s) of unknown directionality ==
+
** 6 associated gene(s):
 +
*** [[Tiso_gene_6815]]
 +
*** [[Tiso_gene_13538]]
 +
*** [[Tiso_gene_12889]]
 +
*** [[Tiso_gene_17809]]
 +
*** [[Tiso_gene_15680]]
 +
*** [[Tiso_gene_17718]]
 +
** 5 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-creinhardtii]]
 +
*** [[orthology-esiliculosus]]
 +
*** [[annotation-experimental_annotation]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=R231-RXN R231-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=R232-RXN R232-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=R233-RXN R233-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=R234-RXN R234-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11108 RXN-11108]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2191}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=10218186 10218186]
+
{{#set: taxonomic range=TAX-94695}}
* CHEMSPIDER:
+
{{#set: common name=coenzyme M biosynthesis II}}
** [http://www.chemspider.com/Chemical-Structure.8393678.html 8393678]
+
{{#set: common name=CoM biosynthesis II}}
* CHEBI:
+
{{#set: reaction found=1}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=9638 9638]
+
{{#set: total reaction=6}}
* LIGAND-CPD:
+
{{#set: completion rate=17.0}}
** [http://www.genome.jp/dbget-bin/www_bget?C08613 C08613]
+
{{#set: smiles=CC(=CC=CC(=CC=CC(=CC=CC(=CC=CC=C(C=CC=C(C=CC1(C(CCCC=1C)(C)C))C)C)C)C)C)C}}
+
{{#set: inchi key=InChIKey=AIBOHNYYKWYQMM-IQKLXLPLSA-N}}
+
{{#set: common name=torulene}}
+
{{#set: molecular weight=534.867    }}
+
{{#set: common name=3',4'-didehydro-β,ψ-carotene}}
+
{{#set: consumed by=RXN-11989}}
+

Revision as of 17:56, 18 March 2018

Pathway PWY-6643

  • taxonomic range:
  • common name:
    • coenzyme M biosynthesis II
  • Synonym(s):
    • CoM biosynthesis II

Reaction(s) found

1 reactions found over 6 reactions in the full pathway

Reaction(s) not found

External links