|
|
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=UDPGLUCEPIM-RXN UDPGLUCEPIM-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYS-GLY CYS-GLY] == |
− | * direction: | + | * smiles: |
− | ** REVERSIBLE | + | ** C(C([O-])=O)NC(C(CS)[N+])=O |
| + | * inchi key: |
| + | ** InChIKey=ZUKPVRWZDMRIEO-VKHMYHEASA-N |
| * common name: | | * common name: |
− | ** udp-glucose_4-epimerase_5 | + | ** L-cysteinyl-glycine |
− | ** udp-glucose_4-epimerase | + | * molecular weight: |
− | * ec number:
| + | ** 178.206 |
− | ** [http://enzyme.expasy.org/EC/5.1.3.2 EC-5.1.3.2] | + | |
| * Synonym(s): | | * Synonym(s): |
| + | ** Cys-Gly |
| + | ** cysteinylglycine |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | * [[RXN-6622]] |
− | ** 1 [[CPD-12575]][c] '''<=>''' 1 [[CPD-14553]][c]
| + | == Reaction(s) known to produce the compound == |
− | * With common name(s):
| + | * [[RXN-6601]] |
− | ** 1 UDP-α-D-glucose[c] '''<=>''' 1 UDP-α-D-galactose[c]
| + | * [[RXN-18092]] |
− | | + | * [[RXN-9157]] |
− | == Genes associated with this reaction ==
| + | == Reaction(s) of unknown directionality == |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * [[Tiso_gene_3236]] | + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***AUTOMATED-NAME-MATCH
| + | |
− | ** [[pantograph]]-[[synechocystis]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_9823]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | ** EXPERIMENTAL_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | ** [[pantograph]]-[[athaliana]]
| + | |
− | ** [[pantograph]]-[[synechocystis]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_10797]]
| + | |
− | ** [[pantograph]]-[[athaliana]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_15395]]
| + | |
− | ** [[pantograph]]-[[athaliana]]
| + | |
− | == Pathways == | + | |
− | * [[PWY-7344]], UDP-D-galactose biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7344 PWY-7344]
| + | |
− | ** '''1''' reactions found over '''1''' reactions in the full pathway
| + | |
− | * [[PWY-6397]], mycolyl-arabinogalactan-peptidoglycan complex biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6397 PWY-6397]
| + | |
− | ** '''2''' reactions found over '''17''' reactions in the full pathway
| + | |
− | * [[PWY-6317]], D-galactose degradation I (Leloir pathway): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6317 PWY-6317]
| + | |
− | ** '''5''' reactions found over '''5''' reactions in the full pathway
| + | |
− | * [[PWY-6527]], stachyose degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6527 PWY-6527]
| + | |
− | ** '''7''' reactions found over '''7''' reactions in the full pathway
| + | |
− | * [[PWY-7328]], superpathway of UDP-glucose-derived O-antigen building blocks biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7328 PWY-7328]
| + | |
− | ** '''5''' reactions found over '''10''' reactions in the full pathway
| + | |
− | * [[COLANSYN-PWY]], colanic acid building blocks biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=COLANSYN-PWY COLANSYN-PWY] | + | |
− | ** '''5''' reactions found over '''11''' reactions in the full pathway
| + | |
− | * [[PWY66-422]], D-galactose degradation V (Leloir pathway): [http://metacyc.org/META/NEW-IMAGE?object=PWY66-422 PWY66-422] | + | |
− | ** '''5''' reactions found over '''5''' reactions in the full pathway
| + | |
− | * [[PWY-3821]], D-galactose degradation III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-3821 PWY-3821] | + | |
− | ** '''3''' reactions found over '''3''' reactions in the full pathway
| + | |
− | == Reconstruction information == | + | |
− | * [[orthology]]:
| + | |
− | ** [[pantograph]]:
| + | |
− | *** [[synechocystis]]
| + | |
− | *** [[athaliana]]
| + | |
− | *** [[esiliculosus]]
| + | |
− | * [[annotation]]:
| + | |
− | ** [[pathwaytools]]:
| + | |
− | *** [[experimental_annotation]]
| + | |
− | *** [[in-silico_annotation]]
| + | |
| == External links == | | == External links == |
− | * RHEA: | + | * BIGG : cgly |
− | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=22168 22168] | + | * PUBCHEM: |
− | * LIGAND-RXN: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7098621 7098621] |
− | ** [http://www.genome.jp/dbget-bin/www_bget?R00291 R00291] | + | * HMDB : HMDB00078 |
− | * UNIPROT: | + | * LIGAND-CPD: |
− | ** [http://www.uniprot.org/uniprot/P35673 P35673] | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01419 C01419] |
− | ** [http://www.uniprot.org/uniprot/P22715 P22715]
| + | * CHEBI: |
− | ** [http://www.uniprot.org/uniprot/P21977 P21977]
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61694 61694] |
− | ** [http://www.uniprot.org/uniprot/P24325 P24325] | + | * METABOLIGHTS : MTBLC4047 |
− | ** [http://www.uniprot.org/uniprot/Q9CE66 Q9CE66]
| + | {{#set: smiles=C(C([O-])=O)NC(C(CS)[N+])=O}} |
− | ** [http://www.uniprot.org/uniprot/Q57664 Q57664]
| + | {{#set: inchi key=InChIKey=ZUKPVRWZDMRIEO-VKHMYHEASA-N}} |
− | ** [http://www.uniprot.org/uniprot/P55180 P55180]
| + | {{#set: common name=L-cysteinyl-glycine}} |
− | ** [http://www.uniprot.org/uniprot/Q9PNG3 Q9PNG3]
| + | {{#set: molecular weight=178.206 }} |
− | ** [http://www.uniprot.org/uniprot/P56997 P56997]
| + | {{#set: common name=Cys-Gly|cysteinylglycine}} |
− | ** [http://www.uniprot.org/uniprot/Q59083 Q59083]
| + | {{#set: consumed by=RXN-6622}} |
− | ** [http://www.uniprot.org/uniprot/Q44016 Q44016]
| + | {{#set: produced by=RXN-6601|RXN-18092|RXN-9157}} |
− | ** [http://www.uniprot.org/uniprot/Q45291 Q45291]
| + | |
− | ** [http://www.uniprot.org/uniprot/P96995 P96995]
| + | |
− | ** [http://www.uniprot.org/uniprot/P45602 P45602]
| + | |
− | ** [http://www.uniprot.org/uniprot/P18645 P18645]
| + | |
− | ** [http://www.uniprot.org/uniprot/P26503 P26503]
| + | |
− | ** [http://www.uniprot.org/uniprot/P40801 P40801]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q05026 Q05026]
| + | |
− | ** [http://www.uniprot.org/uniprot/P56985 P56985]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q51148 Q51148]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q56093 Q56093]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42605 Q42605]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q60109 Q60109]
| + | |
− | ** [http://www.uniprot.org/uniprot/P72903 P72903]
| + | |
− | ** [http://www.uniprot.org/uniprot/P72915 P72915]
| + | |
− | ** [http://www.uniprot.org/uniprot/O66256 O66256]
| + | |
− | ** [http://www.uniprot.org/uniprot/O64749 O64749]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9SN58 Q9SN58]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8VZ26 Q8VZ26]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43070 Q43070]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9T0A7 Q9T0A7]
| + | |
− | ** [http://www.uniprot.org/uniprot/O65780 O65780]
| + | |
− | ** [http://www.uniprot.org/uniprot/O65781 O65781]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9RMC0 Q9RMC0]
| + | |
− | ** [http://www.uniprot.org/uniprot/P04397 P04397]
| + | |
− | ** [http://www.uniprot.org/uniprot/P09147 P09147]
| + | |
− | ** [http://www.uniprot.org/uniprot/P13226 P13226]
| + | |
− | ** [http://www.uniprot.org/uniprot/P09609 P09609]
| + | |
− | {{#set: direction=REVERSIBLE}} | + | |
− | {{#set: common name=udp-glucose_4-epimerase_5}} | + | |
− | {{#set: common name=udp-glucose_4-epimerase}} | + | |
− | {{#set: ec number=EC-5.1.3.2}} | + | |
− | {{#set: gene associated=Tiso_gene_3236|Tiso_gene_9823|Tiso_gene_10797|Tiso_gene_15395}} | + | |
− | {{#set: in pathway=PWY-7344|PWY-6397|PWY-6317|PWY-6527|PWY-7328|COLANSYN-PWY|PWY66-422|PWY-3821}} | + | |
− | {{#set: reconstruction category=orthology}} | + | |
− | {{#set: reconstruction tool=pantograph}}
| + | |
− | {{#set: reconstruction source=synechocystis|athaliana|esiliculosus}}
| + | |
− | {{#set: reconstruction category=annotation}}
| + | |
− | {{#set: reconstruction tool=pathwaytools}}
| + | |
− | {{#set: reconstruction source=experimental_annotation|in-silico_annotation}}
| + | |