Difference between revisions of "RXN-14903"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-136 CPD1F-136] == * smiles: ** C=C1(C4(CC[CH]3(C(C1)(C(O)C[CH]2(C(C([O-])=O)(C)CCCC(C)23)...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ATDCD ATDCD] == * direction: ** LEFT-TO-RIGHT * common name: ** ATP:dCDP phosphotransferase * Synon...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-136 CPD1F-136] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ATDCD ATDCD] ==
−
* smiles:
+
* direction:
−
** C=C1(C4(CC[CH]3(C(C1)(C(O)C[CH]2(C(C([O-])=O)(C)CCCC(C)23))C4)))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=KMLXVEXJZSTMBV-YDIYEOSVSA-M
+
 
* common name:
 
* common name:
−
** ent-7α-hydroxykaur-16-en-19-oate
+
** ATP:dCDP phosphotransferase
−
* molecular weight:
+
−
** 317.447   
+
 
* Synonym(s):
 
* Synonym(s):
−
** ent-7-α-hydroxykaurenoate
 
−
** ent-7-α-hydroxykaurenoic acid
 
−
** 7-hydroxy-kaurenoic acid
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN1F-160]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1.0 [[ATP]][c] '''+''' 1.0 [[DCDP]][c] '''=>''' 1.0 [[DCTP]][c] '''+''' 1.0 [[ADP]][c]
−
* [[1.14.13.79-RXN]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1.0 ATP[c] '''+''' 1.0 dCDP[c] '''=>''' 1.0 dCTP[c] '''+''' 1.0 ADP[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_13128]]
 +
** [[pantograph]]-[[creinhardtii]]
 +
* [[Tiso_gene_16529]]
 +
** [[pantograph]]-[[creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* LIPID_MAPS : LMPR0104540005
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* PUBCHEM:
+
{{#set: common name=ATP:dCDP phosphotransferase}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200352 25200352]
+
{{#set: gene associated=Tiso_gene_13128|Tiso_gene_16529}}
−
* CHEBI:
+
{{#set: in pathway=}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57298 57298]
+
{{#set: reconstruction category=orthology}}
−
* LIGAND-CPD:
+
{{#set: reconstruction source=orthology-creinhardtii}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C11875 C11875]
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: smiles=C=C1(C4(CC[CH]3(C(C1)(C(O)C[CH]2(C(C([O-])=O)(C)CCCC(C)23))C4)))}}
+
−
{{#set: inchi key=InChIKey=KMLXVEXJZSTMBV-YDIYEOSVSA-M}}
+
−
{{#set: common name=ent-7α-hydroxykaur-16-en-19-oate}}
+
−
{{#set: molecular weight=317.447    }}
+
−
{{#set: common name=ent-7-α-hydroxykaurenoate|ent-7-α-hydroxykaurenoic acid|7-hydroxy-kaurenoic acid}}
+
−
{{#set: consumed by=RXN1F-160}}
+
−
{{#set: produced by=1.14.13.79-RXN}}
+

Revision as of 18:58, 18 March 2018

Reaction ATDCD

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • ATP:dCDP phosphotransferase
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 ATP[c] + 1.0 dCDP[c] => 1.0 dCTP[c] + 1.0 ADP[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-14903&oldid=21030"