Difference between revisions of "PWY-6708"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ASN ASN] == * smiles: ** C(CC(C(=O)[O-])[N+])(N)=O * inchi key: ** InChIKey=DCXYFEDJOCDNAF-REOH...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7398 PWY-7398] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ASN ASN] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7398 PWY-7398] ==
* smiles:
+
* taxonomic range:
** C(CC(C(=O)[O-])[N+])(N)=O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
** InChIKey=DCXYFEDJOCDNAF-REOHCLBHSA-N
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 
* common name:
 
* common name:
** L-asparagine
+
** coumarins biosynthesis (engineered)
* molecular weight:
+
** 132.119   
+
 
* Synonym(s):
 
* Synonym(s):
** asparagine
 
** α-aminosuccinamic acid
 
** (-)-asparagine
 
** (S)-2,4-diamino-4-oxobutanoic acid
 
** (S)-asparagine
 
** 2,4-diamino-4-oxobutanoic acid, (S)-
 
** 2-aminosuccinamic acid, L-
 
** agedoite
 
** altheine
 
** asparagine acid
 
** aspartic acid β-amide
 
** butanoic acid, 2,4-diamino-4-oxo-, (S)-
 
** L-2,4-diamino-4-oxobutanoic acid
 
** L-asparatamine
 
** L-β-asparagine
 
** asn
 
** N
 
** L-asn
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[ASPARAGHYD-RXN]]
+
'''3''' reactions found over '''13''' reactions in the full pathway
* [[ASPARAGINE--TRNA-LIGASE-RXN]]
+
* [[4-COUMARATE--COA-LIGASE-RXN]]
* [[RME144]]
+
** 2 associated gene(s):
== Reaction(s) known to produce the compound ==
+
*** [[Tiso_gene_12275]]
* [[RXN-12460]]
+
*** [[Tiso_gene_14183]]
* [[ASNSYNA-RXN]]
+
** 2 reconstruction source(s) associated:
* [[ASNSYNB-RXN]]
+
*** [[orthology-athaliana]]
== Reaction(s) of unknown directionality ==
+
*** [[orthology-esiliculosus]]
 +
* [[CAFFEOYL-COA-O-METHYLTRANSFERASE-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_10561]]
 +
*** [[Tiso_gene_14561]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-1126]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_14183]]
 +
*** [[Tiso_gene_12275]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12349 RXN-12349]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12350 RXN-12350]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12963 RXN-12963]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12965 RXN-12965]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14987 RXN-14987]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14988 RXN-14988]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14990 RXN-14990]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-16762 RXN-16762]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-16763 RXN-16763]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9697 RXN-9697]
 
== External links  ==
 
== External links  ==
* CAS : 70-47-3
+
{{#set: taxonomic range=TAX-4751}}
* METABOLIGHTS : MTBLC58048
+
{{#set: taxonomic range=TAX-33090}}
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6992089 6992089]
+
{{#set: common name=coumarins biosynthesis (engineered)}}
* HMDB : HMDB00168
+
{{#set: reaction found=3}}
* LIGAND-CPD:
+
{{#set: total reaction=13}}
** [http://www.genome.jp/dbget-bin/www_bget?C00152 C00152]
+
{{#set: completion rate=23.0}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58048 58048]
+
* BIGG : asn__L
+
{{#set: smiles=C(CC(C(=O)[O-])[N+])(N)=O}}
+
{{#set: inchi key=InChIKey=DCXYFEDJOCDNAF-REOHCLBHSA-N}}
+
{{#set: common name=L-asparagine}}
+
{{#set: molecular weight=132.119    }}
+
{{#set: common name=asparagine|α-aminosuccinamic acid|(-)-asparagine|(S)-2,4-diamino-4-oxobutanoic acid|(S)-asparagine|2,4-diamino-4-oxobutanoic acid, (S)-|2-aminosuccinamic acid, L-|agedoite|altheine|asparagine acid|aspartic acid β-amide|butanoic acid, 2,4-diamino-4-oxo-, (S)-|L-2,4-diamino-4-oxobutanoic acid|L-asparatamine|L-β-asparagine|asn|N|L-asn}}
+
{{#set: consumed by=ASPARAGHYD-RXN|ASPARAGINE--TRNA-LIGASE-RXN|RME144}}
+
{{#set: produced by=RXN-12460|ASNSYNA-RXN|ASNSYNB-RXN}}
+

Revision as of 17:59, 18 March 2018

Pathway PWY-7398

Reaction(s) found

3 reactions found over 13 reactions in the full pathway

Reaction(s) not found

External links