Difference between revisions of "PWY-6708"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ASN ASN] == * smiles: ** C(CC(C(=O)[O-])[N+])(N)=O * inchi key: ** InChIKey=DCXYFEDJOCDNAF-REOH...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7398 PWY-7398] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7398 PWY-7398] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090] |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
* common name: | * common name: | ||
− | ** | + | ** coumarins biosynthesis (engineered) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | '''3''' reactions found over '''13''' reactions in the full pathway |
− | * [[ | + | * [[4-COUMARATE--COA-LIGASE-RXN]] |
− | * [[ | + | ** 2 associated gene(s): |
− | + | *** [[Tiso_gene_12275]] | |
− | * [[ | + | *** [[Tiso_gene_14183]] |
− | * [[ | + | ** 2 reconstruction source(s) associated: |
− | * [[ | + | *** [[orthology-athaliana]] |
− | == Reaction(s) | + | *** [[orthology-esiliculosus]] |
+ | * [[CAFFEOYL-COA-O-METHYLTRANSFERASE-RXN]] | ||
+ | ** 2 associated gene(s): | ||
+ | *** [[Tiso_gene_10561]] | ||
+ | *** [[Tiso_gene_14561]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[orthology-athaliana]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[RXN-1126]] | ||
+ | ** 2 associated gene(s): | ||
+ | *** [[Tiso_gene_14183]] | ||
+ | *** [[Tiso_gene_12275]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[orthology-athaliana]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12349 RXN-12349] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12350 RXN-12350] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12963 RXN-12963] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12965 RXN-12965] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-14987 RXN-14987] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-14988 RXN-14988] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-14990 RXN-14990] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16762 RXN-16762] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16763 RXN-16763] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9697 RXN-9697] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-4751}} | |
− | + | {{#set: taxonomic range=TAX-33090}} | |
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: common name=coumarins biosynthesis (engineered)}} | |
− | + | {{#set: reaction found=3}} | |
− | + | {{#set: total reaction=13}} | |
− | + | {{#set: completion rate=23.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 17:59, 18 March 2018
Pathway PWY-7398
- taxonomic range:
- common name:
- coumarins biosynthesis (engineered)
- Synonym(s):
Reaction(s) found
3 reactions found over 13 reactions in the full pathway
- 4-COUMARATE--COA-LIGASE-RXN
- 2 associated gene(s):
- 2 reconstruction source(s) associated:
- CAFFEOYL-COA-O-METHYLTRANSFERASE-RXN
- 2 associated gene(s):
- 2 reconstruction source(s) associated:
- RXN-1126
- 2 associated gene(s):
- 2 reconstruction source(s) associated: